7-(3,4-Dimethoxyphenyl)-5-methoxy-6-methyl-3-prop-2-enylbicyclo[3.2.1]oct-3-ene-2,8-dione
Internal ID | febf5d3a-10e7-43ce-86f4-8ec5b297c60b |
Taxonomy | Benzenoids > Benzene and substituted derivatives > Methoxybenzenes > Dimethoxybenzenes |
IUPAC Name | 7-(3,4-dimethoxyphenyl)-5-methoxy-6-methyl-3-prop-2-enylbicyclo[3.2.1]oct-3-ene-2,8-dione |
SMILES (Canonical) | CC1C(C2C(=O)C(=CC1(C2=O)OC)CC=C)C3=CC(=C(C=C3)OC)OC |
SMILES (Isomeric) | CC1C(C2C(=O)C(=CC1(C2=O)OC)CC=C)C3=CC(=C(C=C3)OC)OC |
InChI | InChI=1S/C21H24O5/c1-6-7-14-11-21(26-5)12(2)17(18(19(14)22)20(21)23)13-8-9-15(24-3)16(10-13)25-4/h6,8-12,17-18H,1,7H2,2-5H3 |
InChI Key | HZOCXUMZNWMUHM-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H24O5 |
Molecular Weight | 356.40 g/mol |
Exact Mass | 356.16237386 g/mol |
Topological Polar Surface Area (TPSA) | 61.80 Ų |
XlogP | 3.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.40% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.33% | 86.33% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.58% | 91.11% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 91.03% | 92.94% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 89.04% | 89.62% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.59% | 96.00% |
CHEMBL240 | Q12809 | HERG | 88.23% | 89.76% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.20% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 87.13% | 98.95% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.84% | 90.00% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 84.60% | 96.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 84.02% | 91.49% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.27% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.50% | 97.09% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 80.45% | 82.38% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.39% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Magnolia denudata |
PubChem | 85241929 |
LOTUS | LTS0084501 |
wikiData | Q105035768 |