7-[(2E,6E)-8-hydroxy-3,7-dimethylocta-2,6-dienoxy]chromen-2-one
| Internal ID | 73ae05a1-f962-441d-8189-2cec28ca843d |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
| IUPAC Name | 7-[(2E,6E)-8-hydroxy-3,7-dimethylocta-2,6-dienoxy]chromen-2-one |
| SMILES (Canonical) | CC(=CCOC1=CC2=C(C=C1)C=CC(=O)O2)CCC=C(C)CO |
| SMILES (Isomeric) | C/C(=C\COC1=CC2=C(C=C1)C=CC(=O)O2)/CC/C=C(\C)/CO |
| InChI | InChI=1S/C19H22O4/c1-14(4-3-5-15(2)13-20)10-11-22-17-8-6-16-7-9-19(21)23-18(16)12-17/h5-10,12,20H,3-4,11,13H2,1-2H3/b14-10+,15-5+ |
| InChI Key | UMCTXEGQLBHWGF-QNCWQPSJSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.15180918 g/mol |
| Topological Polar Surface Area (TPSA) | 55.80 Ų |
| XlogP | 4.00 |
| There are no found synonyms. |
![2D Structure of 7-[(2E,6E)-8-hydroxy-3,7-dimethylocta-2,6-dienoxy]chromen-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/7-2e6e-8-hydroxy-37-dimethylocta-26-dienoxychromen-2-one.jpg "2D Structure of 7-[(2E,6E)-8-hydroxy-3,7-dimethylocta-2,6-dienoxy]chromen-2-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2039 | P27338 | Monoamine oxidase B | 98.67% | 92.51% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.20% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.27% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.29% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 93.85% | 94.73% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.91% | 94.00% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 91.80% | 92.08% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 87.14% | 91.49% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.98% | 90.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.59% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.07% | 95.56% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 84.56% | 83.57% |
| CHEMBL4296013 | Q5VWK5 | Interleukin-23 receptor | 83.42% | 88.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cnidium monnieri |
| Prangos pabularia |
| PubChem | 13819674 |
| LOTUS | LTS0155998 |
| wikiData | Q105275490 |