(6R,7S)-3-butylidene-6,7-dihydroxy-4,5,6,7-tetrahydro-2-benzofuran-1-one
Internal ID | 8225c009-30fe-4e37-b336-723019f47b32 |
Taxonomy | Organoheterocyclic compounds > Isobenzofurans |
IUPAC Name | (6R,7S)-3-butylidene-6,7-dihydroxy-4,5,6,7-tetrahydro-2-benzofuran-1-one |
SMILES (Canonical) | CCCC=C1C2=C(C(C(CC2)O)O)C(=O)O1 |
SMILES (Isomeric) | CCCC=C1C2=C([C@@H]([C@@H](CC2)O)O)C(=O)O1 |
InChI | InChI=1S/C12H16O4/c1-2-3-4-9-7-5-6-8(13)11(14)10(7)12(15)16-9/h4,8,11,13-14H,2-3,5-6H2,1H3/t8-,11-/m1/s1 |
InChI Key | DQNGMIQSXNGHOA-LDYMZIIASA-N |
Popularity | 15 references in papers |
Molecular Formula | C12H16O4 |
Molecular Weight | 224.25 g/mol |
Exact Mass | 224.10485899 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | 0.50 |
94596-27-7 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 96.80% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.70% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.67% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.58% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.18% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.77% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.45% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.81% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Angelica acutiloba |
Angelica sinensis |
Conioselinum anthriscoides |
Levisticum officinale |
PubChem | 131874235 |
LOTUS | LTS0191757 |
wikiData | Q105157333 |