(6R,11S)-3-ethyl-4,10-dimethyl-11-(3-methylbut-2-enyl)-2-oxaspiro[5.5]undeca-3,9-diene-1,5-dione
Internal ID | 45e4c4a1-9be2-4517-bff8-47ce072baa40 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
IUPAC Name | (6R,11S)-3-ethyl-4,10-dimethyl-11-(3-methylbut-2-enyl)-2-oxaspiro[5.5]undeca-3,9-diene-1,5-dione |
SMILES (Canonical) | CCC1=C(C(=O)C2(CCC=C(C2CC=C(C)C)C)C(=O)O1)C |
SMILES (Isomeric) | CCC1=C(C(=O)[C@]2(CCC=C([C@@H]2CC=C(C)C)C)C(=O)O1)C |
InChI | InChI=1S/C19H26O3/c1-6-16-14(5)17(20)19(18(21)22-16)11-7-8-13(4)15(19)10-9-12(2)3/h8-9,15H,6-7,10-11H2,1-5H3/t15-,19+/m0/s1 |
InChI Key | ZAPRMARLSZLHMW-HNAYVOBHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H26O3 |
Molecular Weight | 302.40 g/mol |
Exact Mass | 302.18819469 g/mol |
Topological Polar Surface Area (TPSA) | 43.40 Ų |
XlogP | 4.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.91% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.83% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 90.46% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.13% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.22% | 94.73% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.87% | 97.25% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 87.54% | 96.61% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.16% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.14% | 99.23% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.69% | 90.17% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 83.19% | 85.30% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.01% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.99% | 97.09% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.52% | 92.62% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.65% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.37% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Helichrysum petiolare |
PubChem | 162884205 |
LOTUS | LTS0029085 |
wikiData | Q105370023 |