[(2S,3R,4R,5S,6S)-3,5-dihydroxy-2-[[(1S,2S,4S,5S,6R,10S)-2-(hydroxymethyl)-10-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl]oxy]-6-methyloxan-4-yl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate
Internal ID | 4fce008f-51df-4fac-ba88-df5735bb04f6 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Coumaric acids and derivatives |
IUPAC Name | [(2S,3R,4R,5S,6S)-3,5-dihydroxy-2-[[(1S,2S,4S,5S,6R,10S)-2-(hydroxymethyl)-10-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl]oxy]-6-methyloxan-4-yl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C3C=COC(C3C4(C2O4)CO)OC5C(C(C(C(O5)CO)O)O)O)O)OC(=O)C=CC6=CC(=C(C=C6)OC)OC)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@H]2[C@@H]3C=CO[C@H]([C@@H]3[C@@]4([C@H]2O4)CO)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)O)OC(=O)/C=C/C6=CC(=C(C=C6)OC)OC)O |
InChI | InChI=1S/C32H42O17/c1-13-21(36)27(46-19(35)7-5-14-4-6-16(41-2)17(10-14)42-3)25(40)31(44-13)47-26-15-8-9-43-29(20(15)32(12-34)28(26)49-32)48-30-24(39)23(38)22(37)18(11-33)45-30/h4-10,13,15,18,20-31,33-34,36-40H,11-12H2,1-3H3/b7-5+/t13-,15+,18+,20+,21-,22+,23-,24+,25+,26-,27+,28-,29-,30-,31-,32+/m0/s1 |
InChI Key | ATVXWIBQUWJBAT-LMNGJMAOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C32H42O17 |
Molecular Weight | 698.70 g/mol |
Exact Mass | 698.24219987 g/mol |
Topological Polar Surface Area (TPSA) | 245.00 Ų |
XlogP | -1.70 |
There are no found synonyms. |
![2D Structure of [(2S,3R,4R,5S,6S)-3,5-dihydroxy-2-[[(1S,2S,4S,5S,6R,10S)-2-(hydroxymethyl)-10-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl]oxy]-6-methyloxan-4-yl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate 2D Structure of [(2S,3R,4R,5S,6S)-3,5-dihydroxy-2-[[(1S,2S,4S,5S,6R,10S)-2-(hydroxymethyl)-10-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl]oxy]-6-methyloxan-4-yl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/6f8aa280-8845-11ee-bad0-4da04823ff6d.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.08% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 98.67% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 97.38% | 96.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.50% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.49% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.34% | 95.56% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 94.10% | 92.94% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.21% | 85.14% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 92.09% | 97.36% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.26% | 99.17% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.07% | 90.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 85.19% | 86.92% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 84.64% | 91.49% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.78% | 94.73% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.19% | 91.07% |
CHEMBL4829 | O00763 | Acetyl-CoA carboxylase 2 | 83.04% | 98.00% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.73% | 96.21% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.27% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 81.43% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.88% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Verbascum thapsus |
PubChem | 15736679 |
LOTUS | LTS0103611 |
wikiData | Q104918720 |