5,7-Dihydroxy-2-[2-hydroxy-4-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyphenyl]-3-[3,4,5-trihydroxy-6-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxychromen-4-one
Internal ID | 43acc591-f74a-4fc9-86ec-27fc317023fe |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | 5,7-dihydroxy-2-[2-hydroxy-4-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyphenyl]-3-[3,4,5-trihydroxy-6-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(C(C(O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=C(C=C(C=C5)OC6C(C(C(C(O6)COC7C(C(C(C(O7)CO)O)O)O)O)O)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(C(C(C(O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=C(C=C(C=C5)OC6C(C(C(C(O6)COC7C(C(C(C(O7)CO)O)O)O)O)O)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C38H48O26/c1-9-19(43)23(47)28(52)35(57-9)63-38-31(55)26(50)30(54)37(64-38)62-33-22(46)18-14(42)4-10(40)5-15(18)59-32(33)12-3-2-11(6-13(12)41)58-36-29(53)25(49)21(45)17(61-36)8-56-34-27(51)24(48)20(44)16(7-39)60-34/h2-6,9,16-17,19-21,23-31,34-45,47-55H,7-8H2,1H3 |
InChI Key | JAWKJCTZBSHWDG-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C38H48O26 |
Molecular Weight | 920.80 g/mol |
Exact Mass | 920.24338163 g/mol |
Topological Polar Surface Area (TPSA) | 424.00 Ų |
XlogP | -5.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.87% | 91.49% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.62% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.75% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.29% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.86% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.34% | 94.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.80% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.75% | 99.17% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.91% | 99.15% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.84% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 90.72% | 90.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.34% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.03% | 96.09% |
CHEMBL3194 | P02766 | Transthyretin | 86.89% | 90.71% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 86.46% | 86.92% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 85.38% | 95.93% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 83.48% | 95.64% |
CHEMBL220 | P22303 | Acetylcholinesterase | 82.78% | 94.45% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.96% | 95.83% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.63% | 96.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Prunus avium |
PubChem | 162979620 |
LOTUS | LTS0110709 |
wikiData | Q105124106 |