6-Hydroxy-17-[2-hydroxy-6-methyl-7-(3,4,5-trihydroxy-6-methoxyoxan-2-yl)oxyhept-5-en-2-yl]-4,4,8,10,14-pentamethyl-1,2,5,6,7,9,11,12,13,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one
Internal ID | 5737edf1-092c-4018-bce1-57c535985791 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | 6-hydroxy-17-[2-hydroxy-6-methyl-7-(3,4,5-trihydroxy-6-methoxyoxan-2-yl)oxyhept-5-en-2-yl]-4,4,8,10,14-pentamethyl-1,2,5,6,7,9,11,12,13,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
SMILES (Canonical) | CC(=CCCC(C)(C1CCC2(C1CCC3C2(CC(C4C3(CCC(=O)C4(C)C)C)O)C)C)O)COC5C(C(C(C(O5)OC)O)O)O |
SMILES (Isomeric) | CC(=CCCC(C)(C1CCC2(C1CCC3C2(CC(C4C3(CCC(=O)C4(C)C)C)O)C)C)O)COC5C(C(C(C(O5)OC)O)O)O |
InChI | InChI=1S/C36H60O9/c1-20(19-44-31-28(41)26(39)27(40)30(43-8)45-31)10-9-15-36(7,42)22-13-17-34(5)21(22)11-12-24-33(4)16-14-25(38)32(2,3)29(33)23(37)18-35(24,34)6/h10,21-24,26-31,37,39-42H,9,11-19H2,1-8H3 |
InChI Key | WHNRVMKOEVRYPC-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C36H60O9 |
Molecular Weight | 636.90 g/mol |
Exact Mass | 636.42373349 g/mol |
Topological Polar Surface Area (TPSA) | 146.00 Ų |
XlogP | 4.10 |
There are no found synonyms. |
![2D Structure of 6-Hydroxy-17-[2-hydroxy-6-methyl-7-(3,4,5-trihydroxy-6-methoxyoxan-2-yl)oxyhept-5-en-2-yl]-4,4,8,10,14-pentamethyl-1,2,5,6,7,9,11,12,13,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one 2D Structure of 6-Hydroxy-17-[2-hydroxy-6-methyl-7-(3,4,5-trihydroxy-6-methoxyoxan-2-yl)oxyhept-5-en-2-yl]-4,4,8,10,14-pentamethyl-1,2,5,6,7,9,11,12,13,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one](https://plantaedb.com/storage/docs/compounds/2023/11/6e766760-8674-11ee-903e-7dfa112d32fb.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.11% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.28% | 97.25% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.55% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.86% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.76% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.94% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.03% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.89% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.79% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 90.54% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.28% | 95.56% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.47% | 94.75% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.11% | 94.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.20% | 92.62% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.29% | 94.73% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.91% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Hedera rhombea |
PubChem | 162926380 |
LOTUS | LTS0085367 |
wikiData | Q105305456 |