(4S,5'S,7R,8R,8aS)-5'-(furan-3-yl)-4-(hydroxymethyl)-4-methoxy-7-methylspiro[1,2,3,6,7,8a-hexahydronaphthalene-8,3'-oxolane]-2'-one
| Internal ID | 68e5f12f-5d13-47fb-a1a1-78219f66d1ff |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Diterpene lactones |
| IUPAC Name | (4S,5'S,7R,8R,8aS)-5'-(furan-3-yl)-4-(hydroxymethyl)-4-methoxy-7-methylspiro[1,2,3,6,7,8a-hexahydronaphthalene-8,3'-oxolane]-2'-one |
| SMILES (Canonical) | CC1CC=C2C(C13CC(OC3=O)C4=COC=C4)CCCC2(CO)OC |
| SMILES (Isomeric) | C[C@@H]1CC=C2[C@@H]([C@@]13C[C@H](OC3=O)C4=COC=C4)CCC[C@]2(CO)OC |
| InChI | InChI=1S/C20H26O5/c1-13-5-6-15-16(4-3-8-19(15,12-21)23-2)20(13)10-17(25-18(20)22)14-7-9-24-11-14/h6-7,9,11,13,16-17,21H,3-5,8,10,12H2,1-2H3/t13-,16+,17+,19-,20-/m1/s1 |
| InChI Key | WUSIYBBLOFSLDF-VMCMCTHWSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.17802393 g/mol |
| Topological Polar Surface Area (TPSA) | 68.90 Ų |
| XlogP | 1.80 |
| There are no found synonyms. |
![2D Structure of (4S,5'S,7R,8R,8aS)-5'-(furan-3-yl)-4-(hydroxymethyl)-4-methoxy-7-methylspiro[1,2,3,6,7,8a-hexahydronaphthalene-8,3'-oxolane]-2'-one](https://plantaedb.com/storage/docs/compounds/2023/11/6e2f0b20-8336-11ee-86e9-17f8659d85b5.jpg "2D Structure of (4S,5'S,7R,8R,8aS)-5'-(furan-3-yl)-4-(hydroxymethyl)-4-methoxy-7-methylspiro[1,2,3,6,7,8a-hexahydronaphthalene-8,3'-oxolane]-2'-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.90% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.55% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.15% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.29% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.80% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.40% | 86.33% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 88.39% | 83.82% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.81% | 95.89% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.59% | 97.25% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.76% | 94.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.98% | 85.14% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.77% | 86.92% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.56% | 92.62% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.55% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Teucrium polium |
| PubChem | 54598290 |
| LOTUS | LTS0152584 |
| wikiData | Q105313272 |