3,5-Dihydroxy-2-(4-hydroxyphenyl)-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one
Internal ID | 13eb6466-a690-40ca-b169-a31b5fc0d728 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 3,5-dihydroxy-2-(4-hydroxyphenyl)-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one |
SMILES (Canonical) | C1=CC(=CC=C1C2C(C(=O)C3=C(C=C(C=C3O2)OC4C(C(C(C(O4)CO)O)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C2C(C(=O)C3=C(C=C(C=C3O2)OC4C(C(C(C(O4)CO)O)O)O)O)O)O |
InChI | InChI=1S/C21H22O11/c22-7-13-15(25)17(27)19(29)21(32-13)30-10-5-11(24)14-12(6-10)31-20(18(28)16(14)26)8-1-3-9(23)4-2-8/h1-6,13,15,17-25,27-29H,7H2 |
InChI Key | UDIXYHJHYVDNOG-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H22O11 |
Molecular Weight | 450.40 g/mol |
Exact Mass | 450.11621151 g/mol |
Topological Polar Surface Area (TPSA) | 186.00 Ų |
XlogP | 0.00 |
MEGxp0_000241 |
ACon1_001279 |
CHEBI:139457 |
NCGC00169505-01 |
![2D Structure of 3,5-Dihydroxy-2-(4-hydroxyphenyl)-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one 2D Structure of 3,5-Dihydroxy-2-(4-hydroxyphenyl)-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/6e1873c0-855d-11ee-83cc-5927de928f89.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.11% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.94% | 97.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.94% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 91.67% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.83% | 89.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.77% | 99.15% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.44% | 96.09% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 88.19% | 86.92% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.03% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.59% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.04% | 86.33% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 85.72% | 96.21% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.54% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.76% | 99.17% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 82.31% | 91.49% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.60% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Abies nephrolepis |
Afzelia bella |
Cornus mas |
Crocus chrysanthus |
Genista pichisermolliana |
Helichrysum arenarium |
Maclura cochinchinensis |
Maclura pomifera |
Picea abies |
Pseudotsuga menziesii |
PubChem | 14282776 |
LOTUS | LTS0070538 |
wikiData | Q105270386 |