(6E)-6-[[5-(hydroxymethyl)furan-2-yl]methylidene]-7-methyl-7H-cyclopenta[c]pyridin-5-one
| Internal ID | 94ef11f5-a196-4002-af0b-fe0654c24c5f |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > Aryl ketones |
| IUPAC Name | (6E)-6-[[5-(hydroxymethyl)furan-2-yl]methylidene]-7-methyl-7H-cyclopenta[c]pyridin-5-one |
| SMILES (Canonical) | CC1C2=C(C=CN=C2)C(=O)C1=CC3=CC=C(O3)CO |
| SMILES (Isomeric) | CC\1C2=C(C=CN=C2)C(=O)/C1=C/C3=CC=C(O3)CO |
| InChI | InChI=1S/C15H13NO3/c1-9-13(6-10-2-3-11(8-17)19-10)15(18)12-4-5-16-7-14(9)12/h2-7,9,17H,8H2,1H3/b13-6+ |
| InChI Key | OVNLZHRFTIHSTC-AWNIVKPZSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.08954328 g/mol |
| Topological Polar Surface Area (TPSA) | 63.30 Ų |
| XlogP | 1.30 |
| There are no found synonyms. |
![2D Structure of (6E)-6-[[5-(hydroxymethyl)furan-2-yl]methylidene]-7-methyl-7H-cyclopenta[c]pyridin-5-one](https://plantaedb.com/storage/docs/compounds/2023/11/6e-6-5-hydroxymethylfuran-2-ylmethylidene-7-methyl-7h-cyclopentacpyridin-5-one.jpg "2D Structure of (6E)-6-[[5-(hydroxymethyl)furan-2-yl]methylidene]-7-methyl-7H-cyclopenta[c]pyridin-5-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 95.82% | 98.95% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 92.77% | 89.34% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.90% | 89.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.09% | 94.73% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.15% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.06% | 86.33% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 82.29% | 90.24% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 82.28% | 81.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.28% | 96.09% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.99% | 96.90% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 81.32% | 91.24% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.00% | 99.23% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.31% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Harpagophytum zeyheri |
| PubChem | 10706174 |
| LOTUS | LTS0040990 |
| wikiData | Q105200878 |