Methyl 8-benzyl-11-(hydroxymethyl)-2-[[3-(4-hydroxyphenyl)-2-[[1-(5-oxopyrrolidine-2-carbonyl)pyrrolidine-2-carbonyl]amino]propanoyl]amino]-3,6,9,12-tetraoxo-5-propan-2-yl-1,4,7,10,13-pentazatricyclo[14.6.1.017,22]tricosa-16(23),17,19,21-tetraene-14-carboxylate
| Internal ID | 2571a828-52a9-459c-bb45-f7040c0521de |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Cyclic peptides |
| IUPAC Name | methyl 8-benzyl-11-(hydroxymethyl)-2-[[3-(4-hydroxyphenyl)-2-[[1-(5-oxopyrrolidine-2-carbonyl)pyrrolidine-2-carbonyl]amino]propanoyl]amino]-3,6,9,12-tetraoxo-5-propan-2-yl-1,4,7,10,13-pentazatricyclo[14.6.1.017,22]tricosa-16(23),17,19,21-tetraene-14-carboxylate |
| SMILES (Canonical) | CC(C)C1C(=O)NC(C(=O)NC(C(=O)NC(CC2=CN(C(C(=O)N1)NC(=O)C(CC3=CC=C(C=C3)O)NC(=O)C4CCCN4C(=O)C5CCC(=O)N5)C6=CC=CC=C26)C(=O)OC)CO)CC7=CC=CC=C7 |
| SMILES (Isomeric) | CC(C)C1C(=O)NC(C(=O)NC(C(=O)NC(CC2=CN(C(C(=O)N1)NC(=O)C(CC3=CC=C(C=C3)O)NC(=O)C4CCCN4C(=O)C5CCC(=O)N5)C6=CC=CC=C26)C(=O)OC)CO)CC7=CC=CC=C7 |
| InChI | InChI=1S/C50H59N9O12/c1-27(2)41-47(67)53-34(22-28-10-5-4-6-11-28)43(63)55-37(26-60)45(65)54-36(50(70)71-3)24-30-25-59(38-13-8-7-12-32(30)38)42(48(68)56-41)57-44(64)35(23-29-15-17-31(61)18-16-29)52-46(66)39-14-9-21-58(39)49(69)33-19-20-40(62)51-33/h4-8,10-13,15-18,25,27,33-37,39,41-42,60-61H,9,14,19-24,26H2,1-3H3,(H,51,62)(H,52,66)(H,53,67)(H,54,65)(H,55,63)(H,56,68)(H,57,64) |
| InChI Key | HCCOYHQCWLIMRA-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C50H59N9O12 |
| Molecular Weight | 978.10 g/mol |
| Exact Mass | 977.42831835 g/mol |
| Topological Polar Surface Area (TPSA) | 296.00 Ų |
| XlogP | 2.70 |
| Atomic LogP (AlogP) | -0.48 |
| H-Bond Acceptor | 13 |
| H-Bond Donor | 9 |
| Rotatable Bonds | 12 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.8051 | 80.51% |
| Caco-2 | - | 0.8763 | 87.63% |
| Blood Brain Barrier | - | 0.9750 | 97.50% |
| Human oral bioavailability | - | 0.6429 | 64.29% |
| Subcellular localzation | Mitochondria | 0.4657 | 46.57% |
| OATP2B1 inhibitior | - | 0.5733 | 57.33% |
| OATP1B1 inhibitior | + | 0.8335 | 83.35% |
| OATP1B3 inhibitior | + | 0.9194 | 91.94% |
| MATE1 inhibitior | - | 0.7238 | 72.38% |
| OCT2 inhibitior | - | 0.8500 | 85.00% |
| BSEP inhibitior | + | 0.9587 | 95.87% |
| P-glycoprotein inhibitior | + | 0.7522 | 75.22% |
| P-glycoprotein substrate | + | 0.8713 | 87.13% |
| CYP3A4 substrate | + | 0.7555 | 75.55% |
| CYP2C9 substrate | + | 0.6005 | 60.05% |
| CYP2D6 substrate | - | 0.8363 | 83.63% |
| CYP3A4 inhibition | - | 0.7096 | 70.96% |
| CYP2C9 inhibition | - | 0.7132 | 71.32% |
| CYP2C19 inhibition | - | 0.7212 | 72.12% |
| CYP2D6 inhibition | - | 0.8780 | 87.80% |
| CYP1A2 inhibition | - | 0.8854 | 88.54% |
| CYP2C8 inhibition | + | 0.7570 | 75.70% |
| CYP inhibitory promiscuity | + | 0.5121 | 51.21% |
| UGT catelyzed | + | 0.8000 | 80.00% |
| Carcinogenicity (binary) | - | 0.8400 | 84.00% |
| Carcinogenicity (trinary) | Non-required | 0.6317 | 63.17% |
| Eye corrosion | - | 0.9888 | 98.88% |
| Eye irritation | - | 0.9053 | 90.53% |
| Skin irritation | - | 0.7908 | 79.08% |
| Skin corrosion | - | 0.9394 | 93.94% |
| Ames mutagenesis | - | 0.6400 | 64.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6501 | 65.01% |
| Micronuclear | + | 0.8400 | 84.00% |
| Hepatotoxicity | - | 0.5928 | 59.28% |
| skin sensitisation | - | 0.8918 | 89.18% |
| Respiratory toxicity | + | 0.8222 | 82.22% |
| Reproductive toxicity | + | 0.9667 | 96.67% |
| Mitochondrial toxicity | + | 0.9375 | 93.75% |
| Nephrotoxicity | - | 0.7442 | 74.42% |
| Acute Oral Toxicity (c) | III | 0.6204 | 62.04% |
| Estrogen receptor binding | + | 0.8275 | 82.75% |
| Androgen receptor binding | + | 0.6654 | 66.54% |
| Thyroid receptor binding | + | 0.5614 | 56.14% |
| Glucocorticoid receptor binding | + | 0.5582 | 55.82% |
| Aromatase binding | + | 0.6216 | 62.16% |
| PPAR gamma | + | 0.7643 | 76.43% |
| Honey bee toxicity | - | 0.6695 | 66.95% |
| Biodegradation | - | 0.8250 | 82.50% |
| Crustacea aquatic toxicity | + | 0.6000 | 60.00% |
| Fish aquatic toxicity | + | 0.6850 | 68.50% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.94% | 98.95% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 99.19% | 90.08% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 99.06% | 97.64% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.41% | 96.09% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 97.92% | 93.99% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.22% | 95.56% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 97.03% | 97.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.24% | 94.45% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 96.21% | 91.71% |
| CHEMBL3837 | P07711 | Cathepsin L | 96.15% | 96.61% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.45% | 91.11% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 95.41% | 95.89% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 92.57% | 88.56% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 91.58% | 92.97% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.55% | 97.09% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.89% | 95.89% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 90.04% | 83.82% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 89.79% | 93.10% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 89.10% | 98.24% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.40% | 94.75% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.44% | 99.17% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.80% | 91.19% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 86.80% | 92.67% |
| CHEMBL4644 | P41968 | Melanocortin receptor 3 | 86.44% | 99.52% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.82% | 98.75% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 85.43% | 89.67% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.18% | 85.14% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 85.17% | 95.38% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 84.77% | 95.83% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.38% | 93.56% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.38% | 95.50% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 84.24% | 82.69% |
| CHEMBL5314 | Q06418 | Tyrosine-protein kinase receptor TYRO3 | 84.17% | 96.00% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 83.86% | 95.71% |
| CHEMBL1921 | P47901 | Vasopressin V1b receptor | 83.67% | 92.50% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.43% | 90.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.36% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.92% | 89.00% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.86% | 96.47% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 82.72% | 94.66% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 82.00% | 95.62% |
| CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 81.63% | 90.95% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 81.40% | 96.67% |
| CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 81.23% | 97.43% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.77% | 93.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.62% | 100.00% |
| CHEMBL4393 | P39900 | Matrix metalloproteinase 12 | 80.53% | 92.22% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 80.33% | 94.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Celosia argentea |
| PubChem | 75051970 |
| LOTUS | LTS0207543 |
| wikiData | Q105025607 |