(6S)-3,8,10-trihydroxy-9-[(E)-3-methylbut-1-enyl]-6-(2-methylprop-1-enyl)-6H-chromeno[4,3-b]chromen-7-one
| Internal ID | 8b51a3b2-6df7-4194-8750-52b9659c4bfb |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Pyranoflavonoids |
| IUPAC Name | (6S)-3,8,10-trihydroxy-9-[(E)-3-methylbut-1-enyl]-6-(2-methylprop-1-enyl)-6H-chromeno[4,3-b]chromen-7-one |
| SMILES (Canonical) | CC(C)C=CC1=C(C2=C(C=C1O)OC3=C(C2=O)C(OC4=C3C=CC(=C4)O)C=C(C)C)O |
| SMILES (Isomeric) | CC(C)/C=C/C1=C(C2=C(C=C1O)OC3=C(C2=O)[C@@H](OC4=C3C=CC(=C4)O)C=C(C)C)O |
| InChI | InChI=1S/C25H24O6/c1-12(2)5-7-15-17(27)11-20-21(23(15)28)24(29)22-19(9-13(3)4)30-18-10-14(26)6-8-16(18)25(22)31-20/h5-12,19,26-28H,1-4H3/b7-5+/t19-/m0/s1 |
| InChI Key | AXHZIEAQVMBUKO-XZXOBPBMSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C25H24O6 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.15728848 g/mol |
| Topological Polar Surface Area (TPSA) | 96.20 Ų |
| XlogP | 5.70 |
| There are no found synonyms. |
![2D Structure of (6S)-3,8,10-trihydroxy-9-[(E)-3-methylbut-1-enyl]-6-(2-methylprop-1-enyl)-6H-chromeno[4,3-b]chromen-7-one](https://plantaedb.com/storage/docs/compounds/2023/11/6ced4890-81ac-11ee-b55f-bd1378380516.jpg "2D Structure of (6S)-3,8,10-trihydroxy-9-[(E)-3-methylbut-1-enyl]-6-(2-methylprop-1-enyl)-6H-chromeno[4,3-b]chromen-7-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.35% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.90% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.24% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.04% | 95.56% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 91.23% | 83.10% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 91.15% | 93.10% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 89.15% | 91.49% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.81% | 90.71% |
| CHEMBL3194 | P02766 | Transthyretin | 88.46% | 90.71% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.32% | 94.73% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.61% | 99.15% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 84.41% | 90.93% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.03% | 94.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.70% | 85.14% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 81.82% | 85.11% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.32% | 95.89% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.16% | 86.33% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 80.05% | 91.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Artocarpus heterophyllus |
| Artocarpus hypargyreus |
| PubChem | 162885668 |
| LOTUS | LTS0250184 |
| wikiData | Q104920569 |