3-[(2S,3R,4S,5S)-3,4-dihydroxy-5-[(1S)-1-hydroxyethyl]oxolan-2-yl]oxy-2-[4-[(2S,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxyphenyl]-5,7-dihydroxychromen-4-one
Internal ID | c7e52b19-0438-48df-a698-c9c58bb41e73 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | 3-[(2S,3R,4S,5S)-3,4-dihydroxy-5-[(1S)-1-hydroxyethyl]oxolan-2-yl]oxy-2-[4-[(2S,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxyphenyl]-5,7-dihydroxychromen-4-one |
SMILES (Canonical) | CC(C1C(C(C(O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC=C(C=C4)OC5C(C(C(O5)CO)O)O)O)O)O |
SMILES (Isomeric) | C[C@@H]([C@H]1[C@H]([C@H]([C@@H](O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC=C(C=C4)O[C@H]5[C@@H]([C@H]([C@@H](O5)CO)O)O)O)O)O |
InChI | InChI=1S/C26H28O14/c1-9(28)22-19(33)21(35)26(39-22)40-24-18(32)16-13(30)6-11(29)7-14(16)37-23(24)10-2-4-12(5-3-10)36-25-20(34)17(31)15(8-27)38-25/h2-7,9,15,17,19-22,25-31,33-35H,8H2,1H3/t9-,15-,17-,19-,20+,21+,22-,25+,26-/m0/s1 |
InChI Key | PNEKVLUOGHZVKV-YRRKUQMFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H28O14 |
Molecular Weight | 564.50 g/mol |
Exact Mass | 564.14790556 g/mol |
Topological Polar Surface Area (TPSA) | 225.00 Ų |
XlogP | 0.60 |
There are no found synonyms. |
![2D Structure of 3-[(2S,3R,4S,5S)-3,4-dihydroxy-5-[(1S)-1-hydroxyethyl]oxolan-2-yl]oxy-2-[4-[(2S,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxyphenyl]-5,7-dihydroxychromen-4-one 2D Structure of 3-[(2S,3R,4S,5S)-3,4-dihydroxy-5-[(1S)-1-hydroxyethyl]oxolan-2-yl]oxy-2-[4-[(2S,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxyphenyl]-5,7-dihydroxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/6c4fb150-85b6-11ee-a9c3-19e24290f8ee.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.51% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.90% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.98% | 89.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 96.46% | 99.15% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.07% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.65% | 94.73% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.44% | 94.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.93% | 99.17% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 91.34% | 86.92% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.72% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.70% | 97.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.82% | 90.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.68% | 86.33% |
CHEMBL220 | P22303 | Acetylcholinesterase | 87.49% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.37% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.63% | 95.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.89% | 90.71% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 84.56% | 95.64% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.06% | 95.89% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.90% | 95.89% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 82.09% | 96.12% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.31% | 96.00% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 80.60% | 95.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Prunus spinosa |
PubChem | 162848979 |
LOTUS | LTS0065327 |
wikiData | Q105211885 |