[(1S,2S,3R,8S,10S,11S,15R,16R)-3-acetyloxy-15-[(2S,3R,5S)-2-acetyloxy-5-[(2R)-3,3-dimethyloxiran-2-yl]oxolan-3-yl]-2,7,7,11,16-pentamethyl-5-oxo-6-oxatetracyclo[9.7.0.02,8.012,16]octadec-12-en-10-yl] acetate
| Internal ID | 7af9ace4-ca81-44a5-94e3-22ce59451df4 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids > Limonoids |
| IUPAC Name | [(1S,2S,3R,8S,10S,11S,15R,16R)-3-acetyloxy-15-[(2S,3R,5S)-2-acetyloxy-5-[(2R)-3,3-dimethyloxiran-2-yl]oxolan-3-yl]-2,7,7,11,16-pentamethyl-5-oxo-6-oxatetracyclo[9.7.0.02,8.012,16]octadec-12-en-10-yl] acetate |
| SMILES (Canonical) | CC(=O)OC1CC2C(OC(=O)CC(C2(C3C1(C4=CCC(C4(CC3)C)C5CC(OC5OC(=O)C)C6C(O6)(C)C)C)C)OC(=O)C)(C)C |
| SMILES (Isomeric) | CC(=O)O[C@H]1C[C@H]2[C@]([C@H]3[C@]1(C4=CC[C@@H]([C@]4(CC3)C)[C@H]5C[C@H](O[C@H]5OC(=O)C)[C@@H]6C(O6)(C)C)C)([C@@H](CC(=O)OC2(C)C)OC(=O)C)C |
| InChI | InChI=1S/C36H52O10/c1-18(37)41-27-16-26-32(4,5)45-29(40)17-28(42-19(2)38)36(26,10)25-13-14-34(8)22(11-12-24(34)35(25,27)9)21-15-23(30-33(6,7)46-30)44-31(21)43-20(3)39/h12,21-23,25-28,30-31H,11,13-17H2,1-10H3/t21-,22-,23+,25-,26-,27+,28-,30-,31-,34-,35-,36+/m1/s1 |
| InChI Key | AVVJHONDHCEGRL-UQZRSPGOSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C36H52O10 |
| Molecular Weight | 644.80 g/mol |
| Exact Mass | 644.35604785 g/mol |
| Topological Polar Surface Area (TPSA) | 127.00 Ų |
| XlogP | 5.10 |
| There are no found synonyms. |
![2D Structure of [(1S,2S,3R,8S,10S,11S,15R,16R)-3-acetyloxy-15-[(2S,3R,5S)-2-acetyloxy-5-[(2R)-3,3-dimethyloxiran-2-yl]oxolan-3-yl]-2,7,7,11,16-pentamethyl-5-oxo-6-oxatetracyclo[9.7.0.02,8.012,16]octadec-12-en-10-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/6c1811c0-852d-11ee-b4f9-bbb866dd25ad.jpg "2D Structure of [(1S,2S,3R,8S,10S,11S,15R,16R)-3-acetyloxy-15-[(2S,3R,5S)-2-acetyloxy-5-[(2R)-3,3-dimethyloxiran-2-yl]oxolan-3-yl]-2,7,7,11,16-pentamethyl-5-oxo-6-oxatetracyclo[9.7.0.02,8.012,16]octadec-12-en-10-yl] acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.04% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.82% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.81% | 85.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.30% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.84% | 95.56% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.86% | 100.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.80% | 91.19% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 89.27% | 89.05% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.01% | 98.95% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.98% | 94.75% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.71% | 97.09% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.79% | 97.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.21% | 89.00% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 86.88% | 93.04% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.88% | 99.23% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.80% | 92.50% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.36% | 86.33% |
| CHEMBL5028 | O14672 | ADAM10 | 81.41% | 97.50% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.01% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Luvunga sarmentosa |
| PubChem | 162954867 |
| LOTUS | LTS0126733 |
| wikiData | Q104919858 |