[4-Hydroxy-3-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyloxy]-5-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyloxymethyl]-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxolan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate
Internal ID | 39bb9b22-0aaa-4bec-b980-f1376d519ed1 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Hydroxycinnamic acid esters > Coumaric acid esters |
IUPAC Name | [4-hydroxy-3-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyloxy]-5-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyloxymethyl]-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxolan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | COC1=C(C=CC(=C1)C=CC(=O)OCC2C(C(C(O2)(COC(=O)C=CC3=CC=C(C=C3)O)OC4C(C(C(C(O4)CO)O)O)O)OC(=O)C=CC5=CC(=C(C=C5)O)OC)O)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)C=CC(=O)OCC2C(C(C(O2)(COC(=O)C=CC3=CC=C(C=C3)O)OC4C(C(C(C(O4)CO)O)O)O)OC(=O)C=CC5=CC(=C(C=C5)O)OC)O)O |
InChI | InChI=1S/C41H44O19/c1-53-28-17-23(5-12-26(28)44)8-15-32(46)55-20-31-36(50)39(58-34(48)16-9-24-6-13-27(45)29(18-24)54-2)41(59-31,60-40-38(52)37(51)35(49)30(19-42)57-40)21-56-33(47)14-7-22-3-10-25(43)11-4-22/h3-18,30-31,35-40,42-45,49-52H,19-21H2,1-2H3 |
InChI Key | XPMSXAVTDBNKAT-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C41H44O19 |
Molecular Weight | 840.80 g/mol |
Exact Mass | 840.24767917 g/mol |
Topological Polar Surface Area (TPSA) | 287.00 Ų |
XlogP | 1.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.60% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.05% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.53% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.39% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.17% | 95.56% |
CHEMBL3194 | P02766 | Transthyretin | 93.13% | 90.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.19% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.11% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.27% | 99.17% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 89.80% | 89.62% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.68% | 97.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.12% | 90.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.75% | 95.50% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 84.66% | 97.36% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.36% | 85.14% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.04% | 91.19% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.78% | 94.45% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 81.25% | 89.67% |
CHEMBL2535 | P11166 | Glucose transporter | 80.89% | 98.75% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.89% | 95.89% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 80.43% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.24% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Smilax bracteata |
Smilax china |
PubChem | 85316105 |
LOTUS | LTS0056352 |
wikiData | Q105338854 |