7-Hydroxy-5-methoxy-2-[3-methoxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one
Internal ID | c935ac00-fad1-45e5-a484-58cc05a373e1 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides |
IUPAC Name | 7-hydroxy-5-methoxy-2-[3-methoxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one |
SMILES (Canonical) | COC1=CC(=CC2=C1C(=O)C=C(O2)C3=CC(=C(C=C3)OC4C(C(C(C(O4)CO)O)O)O)OC)O |
SMILES (Isomeric) | COC1=CC(=CC2=C1C(=O)C=C(O2)C3=CC(=C(C=C3)OC4C(C(C(C(O4)CO)O)O)O)OC)O |
InChI | InChI=1S/C23H24O11/c1-30-15-5-10(14-8-12(26)19-16(31-2)6-11(25)7-17(19)32-14)3-4-13(15)33-23-22(29)21(28)20(27)18(9-24)34-23/h3-8,18,20-25,27-29H,9H2,1-2H3 |
InChI Key | YCNOLVHYPHEILG-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H24O11 |
Molecular Weight | 476.40 g/mol |
Exact Mass | 476.13186158 g/mol |
Topological Polar Surface Area (TPSA) | 164.00 Ų |
XlogP | 0.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.49% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 96.33% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.73% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.38% | 85.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.17% | 89.00% |
CHEMBL220 | P22303 | Acetylcholinesterase | 95.15% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.34% | 96.09% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 92.85% | 86.92% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 91.93% | 96.21% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.42% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.06% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.21% | 99.17% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 87.13% | 95.78% |
CHEMBL3194 | P02766 | Transthyretin | 86.72% | 90.71% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.47% | 94.73% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.43% | 96.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.21% | 90.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.08% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Pyrus pyrifolia |
PubChem | 162884708 |
LOTUS | LTS0238733 |
wikiData | Q105346373 |