9-Hydroxy-6-(4-hydroxyphenyl)-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-[1,3]dioxolo[4,5-g]chromen-8-one
Internal ID | 7bf82e00-3c51-4c89-ac9a-6464d18648a5 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | 9-hydroxy-6-(4-hydroxyphenyl)-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-[1,3]dioxolo[4,5-g]chromen-8-one |
SMILES (Canonical) | C1OC2=C(O1)C(=C3C(=C2)OC(=C(C3=O)OC4C(C(C(C(O4)CO)O)O)O)C5=CC=C(C=C5)O)O |
SMILES (Isomeric) | C1OC2=C(O1)C(=C3C(=C2)OC(=C(C3=O)OC4C(C(C(C(O4)CO)O)O)O)C5=CC=C(C=C5)O)O |
InChI | InChI=1S/C22H20O12/c23-6-12-14(25)17(28)18(29)22(33-12)34-21-16(27)13-10(5-11-20(15(13)26)31-7-30-11)32-19(21)8-1-3-9(24)4-2-8/h1-5,12,14,17-18,22-26,28-29H,6-7H2 |
InChI Key | PEBSHTGUNSXVEZ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H20O12 |
Molecular Weight | 476.40 g/mol |
Exact Mass | 476.09547607 g/mol |
Topological Polar Surface Area (TPSA) | 185.00 Ų |
XlogP | 0.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.61% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.19% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.56% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.77% | 94.45% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.93% | 94.00% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 92.09% | 95.64% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.89% | 97.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 91.86% | 96.77% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.99% | 94.73% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.14% | 85.14% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 88.66% | 95.78% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.49% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.70% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.62% | 99.15% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.73% | 100.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.60% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.01% | 95.56% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.77% | 95.89% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.09% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.57% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Persicaria tinctoria |
PubChem | 14542803 |
LOTUS | LTS0147625 |
wikiData | Q105206891 |