(2R,3S,5R,8R,10S,12R)-2-hydroxy-5,10,15-trimethyl-4,9,13-trioxatetracyclo[10.3.0.03,5.08,10]pentadec-1(15)-en-14-one
Internal ID | 22475bfe-8aca-476b-8662-31a4a7f289eb |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
IUPAC Name | (2R,3S,5R,8R,10S,12R)-2-hydroxy-5,10,15-trimethyl-4,9,13-trioxatetracyclo[10.3.0.03,5.08,10]pentadec-1(15)-en-14-one |
SMILES (Canonical) | CC1=C2C(CC3(C(O3)CCC4(C(C2O)O4)C)C)OC1=O |
SMILES (Isomeric) | CC1=C2[C@@H](C[C@]3([C@H](O3)CC[C@@]4([C@H]([C@@H]2O)O4)C)C)OC1=O |
InChI | InChI=1S/C15H20O5/c1-7-10-8(18-13(7)17)6-15(3)9(19-15)4-5-14(2)12(20-14)11(10)16/h8-9,11-12,16H,4-6H2,1-3H3/t8-,9-,11-,12+,14-,15+/m1/s1 |
InChI Key | BWSYOMVQMMVGIN-RSSMSPSSSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H20O5 |
Molecular Weight | 280.32 g/mol |
Exact Mass | 280.13107373 g/mol |
Topological Polar Surface Area (TPSA) | 71.60 Ų |
XlogP | 0.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.05% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.83% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.65% | 89.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.09% | 99.23% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 85.97% | 89.63% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.63% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.03% | 97.09% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 84.41% | 96.61% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.55% | 97.14% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.52% | 85.14% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 81.47% | 94.78% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.05% | 100.00% |
CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 80.74% | 96.25% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.39% | 86.33% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.23% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Smyrnium olusatrum |
PubChem | 162984703 |
LOTUS | LTS0233417 |
wikiData | Q104947664 |