2-[4-Hydroxy-2-(hydroxymethyl)-6-[[6-hydroxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl]oxy]-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | 6dd1a014-67af-4612-8b76-91bcc48d431c |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | 2-[4-hydroxy-2-(hydroxymethyl)-6-[[6-hydroxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl]oxy]-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CCC5C4(CCC(C5)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)C)O)O)O)O)OC8C(C(C(C(O8)CO)O)O)O)C)C)OC1(CCC(C)COC9C(C(C(C(O9)CO)O)O)O)O |
SMILES (Isomeric) | CC1C2C(CC3C2(CCC4C3CCC5C4(CCC(C5)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)C)O)O)O)O)OC8C(C(C(C(O8)CO)O)O)O)C)C)OC1(CCC(C)COC9C(C(C(C(O9)CO)O)O)O)O |
InChI | InChI=1S/C51H86O23/c1-20(19-66-45-39(61)37(59)34(56)29(16-52)69-45)8-13-51(65)21(2)32-28(74-51)15-27-25-7-6-23-14-24(9-11-49(23,4)26(25)10-12-50(27,32)5)68-48-44(73-47-41(63)38(60)35(57)30(17-53)70-47)42(64)43(31(18-54)71-48)72-46-40(62)36(58)33(55)22(3)67-46/h20-48,52-65H,6-19H2,1-5H3 |
InChI Key | YLKFQDKSCLMOGF-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C51H86O23 |
Molecular Weight | 1067.20 g/mol |
Exact Mass | 1066.55598899 g/mol |
Topological Polar Surface Area (TPSA) | 366.00 Ų |
XlogP | -0.90 |
There are no found synonyms. |
![2D Structure of 2-[4-Hydroxy-2-(hydroxymethyl)-6-[[6-hydroxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl]oxy]-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol 2D Structure of 2-[4-Hydroxy-2-(hydroxymethyl)-6-[[6-hydroxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl]oxy]-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/68482da0-8752-11ee-a133-b3eaf216156d.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.10% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.68% | 91.11% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 94.98% | 92.86% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.27% | 97.09% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 93.08% | 98.05% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 92.97% | 96.61% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 92.84% | 89.05% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 92.79% | 95.93% |
CHEMBL237 | P41145 | Kappa opioid receptor | 92.47% | 98.10% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 92.19% | 96.21% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 91.83% | 97.29% |
CHEMBL233 | P35372 | Mu opioid receptor | 91.20% | 97.93% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 90.85% | 95.36% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.42% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.08% | 94.45% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.07% | 95.89% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 88.42% | 98.46% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 87.48% | 97.31% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 86.99% | 95.58% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 86.81% | 93.18% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.69% | 97.25% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.61% | 89.00% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 86.54% | 97.86% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 86.35% | 92.98% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.66% | 93.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.85% | 95.89% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 84.83% | 97.79% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 84.19% | 97.50% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.69% | 100.00% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 83.08% | 97.64% |
CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 82.62% | 96.31% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.47% | 92.94% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.43% | 100.00% |
CHEMBL220 | P22303 | Acetylcholinesterase | 82.00% | 94.45% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.75% | 95.50% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.66% | 91.71% |
CHEMBL2360 | P00492 | Hypoxanthine-guanine phosphoribosyltransferase | 81.64% | 87.38% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 81.24% | 92.32% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.06% | 92.50% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 80.73% | 98.35% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 80.72% | 92.78% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.51% | 96.47% |
CHEMBL5524 | Q99873 | Protein-arginine N-methyltransferase 1 | 80.31% | 96.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Asparagus racemosus |
Smilax aspera |
PubChem | 73256797 |
LOTUS | LTS0075399 |
wikiData | Q105108148 |