(Z)-6-beta,16-beta-dihydroxy-3,7-dioxo-29-nor-8-alpha,9-beta,13-alpha,14-beta-dammara-1,17(20),24-trien-21-oic acid diacetate
Internal ID | 0a53c922-9327-44fa-b851-c991b79c1b7d |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid esters |
IUPAC Name | (2E)-2-[(4S,5S,6S,8S,9S,10R,13R,14S,16S)-6,16-diacetyloxy-4,8,10,14-tetramethyl-3,7-dioxo-5,6,9,11,12,13,15,16-octahydro-4H-cyclopenta[a]phenanthren-17-ylidene]-6-methylhept-5-enoic acid |
SMILES (Canonical) | CC1C2C(C(=O)C3(C(C2(C=CC1=O)C)CCC4C3(CC(C4=C(CCC=C(C)C)C(=O)O)OC(=O)C)C)C)OC(=O)C |
SMILES (Isomeric) | C[C@H]1[C@@H]2[C@@H](C(=O)[C@]3([C@H]([C@]2(C=CC1=O)C)CC[C@@H]\4[C@@]3(C[C@@H](/C4=C(\CCC=C(C)C)/C(=O)O)OC(=O)C)C)C)OC(=O)C |
InChI | InChI=1S/C33H44O8/c1-17(2)10-9-11-21(30(38)39)26-22-12-13-25-31(6)15-14-23(36)18(3)27(31)28(41-20(5)35)29(37)33(25,8)32(22,7)16-24(26)40-19(4)34/h10,14-15,18,22,24-25,27-28H,9,11-13,16H2,1-8H3,(H,38,39)/b26-21+/t18-,22+,24+,25+,27-,28+,31-,32+,33-/m1/s1 |
InChI Key | MDFZYGLOIJNNRM-IGFLZCFRSA-N |
Popularity | 0 references in papers |
Molecular Formula | C33H44O8 |
Molecular Weight | 568.70 g/mol |
Exact Mass | 568.30361836 g/mol |
Topological Polar Surface Area (TPSA) | 124.00 Ų |
XlogP | 5.10 |
C33-H44-O8 |
SCHEMBL887091 |
(Z)-6-beta,16-beta-dihydroxy-3,7-dioxo-29-nor-8-alpha,9-beta,13-alpha,14-beta-dammara-1,17(20),24-trien-21-oic acid diacetate |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.62% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.61% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 95.30% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.59% | 94.45% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.47% | 97.25% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 90.05% | 94.62% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 88.43% | 93.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.74% | 90.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.54% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.05% | 86.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.70% | 100.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.63% | 99.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.53% | 89.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.78% | 85.14% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.21% | 95.50% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.26% | 91.19% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.09% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Petroselinum crispum |