5a,5b,8,8,11a-Pentamethyl-1-prop-1-en-2-yl-1,2,3,3a,4,5,6,7,7a,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-one
| Internal ID | c74ee841-db82-4e2a-ae88-2f35f6de0f83 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | 5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,3a,4,5,6,7,7a,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-one |
| SMILES (Canonical) | CC(=C)C1CCC2C1C3CCC4C5(CCC(=O)C(C5CCC4(C3(CC2)C)C)(C)C)C |
| SMILES (Isomeric) | CC(=C)C1CCC2C1C3CCC4C5(CCC(=O)C(C5CCC4(C3(CC2)C)C)(C)C)C |
| InChI | InChI=1S/C29H46O/c1-18(2)20-9-8-19-12-16-28(6)21(25(19)20)10-11-23-27(5)15-14-24(30)26(3,4)22(27)13-17-29(23,28)7/h19-23,25H,1,8-17H2,2-7H3 |
| InChI Key | CYMSAIHZYKEMJW-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C29H46O |
| Molecular Weight | 410.70 g/mol |
| Exact Mass | 410.354866087 g/mol |
| Topological Polar Surface Area (TPSA) | 17.10 Ų |
| XlogP | 9.20 |
| There are no found synonyms. |
![2D Structure of 5a,5b,8,8,11a-Pentamethyl-1-prop-1-en-2-yl-1,2,3,3a,4,5,6,7,7a,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-one](https://plantaedb.com/storage/docs/compounds/2023/11/676ebca0-8410-11ee-953f-19818fc90b5e.jpg "2D Structure of 5a,5b,8,8,11a-Pentamethyl-1-prop-1-en-2-yl-1,2,3,3a,4,5,6,7,7a,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.52% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.05% | 96.09% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 89.90% | 82.69% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.88% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.04% | 97.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.63% | 100.00% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 87.61% | 93.04% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.48% | 94.45% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 85.98% | 96.38% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.89% | 98.95% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.17% | 96.61% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.01% | 90.17% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.64% | 94.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.03% | 95.56% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.09% | 91.19% |
| CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 81.83% | 95.69% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.75% | 90.71% |
| CHEMBL4072 | P07858 | Cathepsin B | 80.02% | 93.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Pistacia lentiscus |
| PubChem | 77443234 |
| LOTUS | LTS0175910 |
| wikiData | Q104972422 |