4-(carboxymethyl)-3-ethenyl-2-[3,4,5-trihydroxy-6-[3-(4-hydroxyphenyl)prop-2-enoyloxymethyl]oxan-2-yl]oxy-3,4-dihydro-2H-pyran-5-carboxylic acid
Internal ID | f00bec12-0d58-4c32-81f1-e3354561783e |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
IUPAC Name | 4-(carboxymethyl)-3-ethenyl-2-[3,4,5-trihydroxy-6-[3-(4-hydroxyphenyl)prop-2-enoyloxymethyl]oxan-2-yl]oxy-3,4-dihydro-2H-pyran-5-carboxylic acid |
SMILES (Canonical) | C=CC1C(C(=COC1OC2C(C(C(C(O2)COC(=O)C=CC3=CC=C(C=C3)O)O)O)O)C(=O)O)CC(=O)O |
SMILES (Isomeric) | C=CC1C(C(=COC1OC2C(C(C(C(O2)COC(=O)C=CC3=CC=C(C=C3)O)O)O)O)C(=O)O)CC(=O)O |
InChI | InChI=1S/C25H28O13/c1-2-14-15(9-18(27)28)16(23(33)34)10-36-24(14)38-25-22(32)21(31)20(30)17(37-25)11-35-19(29)8-5-12-3-6-13(26)7-4-12/h2-8,10,14-15,17,20-22,24-26,30-32H,1,9,11H2,(H,27,28)(H,33,34) |
InChI Key | PCGBNHHRMPPSJJ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H28O13 |
Molecular Weight | 536.50 g/mol |
Exact Mass | 536.15299094 g/mol |
Topological Polar Surface Area (TPSA) | 210.00 Ų |
XlogP | -0.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.26% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.95% | 86.33% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.88% | 91.11% |
CHEMBL3194 | P02766 | Transthyretin | 92.72% | 90.71% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.76% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.35% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.30% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.77% | 89.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.83% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.79% | 94.73% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 83.65% | 89.67% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 82.76% | 94.62% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.01% | 90.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.85% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Olea europaea |
PubChem | 163004618 |
LOTUS | LTS0092520 |
wikiData | Q105205710 |