6,7-Dimethoxyisoquinoline
| Internal ID | 9c3eaebb-2736-4d86-95de-aefb44583169 |
| Taxonomy | Organoheterocyclic compounds > Isoquinolines and derivatives |
| IUPAC Name | 6,7-dimethoxyisoquinoline |
| SMILES (Canonical) | COC1=C(C=C2C=NC=CC2=C1)OC |
| SMILES (Isomeric) | COC1=C(C=C2C=NC=CC2=C1)OC |
| InChI | InChI=1S/C11H11NO2/c1-13-10-5-8-3-4-12-7-9(8)6-11(10)14-2/h3-7H,1-2H3 |
| InChI Key | JAJVYESKUNMYPN-UHFFFAOYSA-N |
| Popularity | 37 references in papers |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.078978594 g/mol |
| Topological Polar Surface Area (TPSA) | 31.40 Ų |
| XlogP | 2.00 |
| 15248-39-2 |
| Backebergine |
| isoquinoline, 6,7-dimethoxy- |
| U7Z274S93H |
| 6,7-dimethoxy-isoquinoline |
| C09348 |
| UNII-U7Z274S93H |
| CHEBI:2971 |
| SCHEMBL1271246 |
| DTXSID50165032 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.77% | 86.33% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 91.07% | 85.30% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.69% | 94.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.63% | 98.75% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 87.58% | 95.12% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 87.32% | 97.53% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.32% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.94% | 90.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.13% | 96.00% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 85.06% | 97.36% |
| CHEMBL4158 | P49327 | Fatty acid synthase | 84.54% | 82.50% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.15% | 94.45% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 82.85% | 96.47% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 81.93% | 90.24% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.87% | 100.00% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 81.41% | 93.65% |
| CHEMBL1907599 | P05556 | Integrin alpha-4/beta-1 | 81.03% | 92.86% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Backebergia militaris |
| Hernandia sonora |
| Pachycereus weberi |
| Xylopia parviflora |
| PubChem | 177578 |
| LOTUS | LTS0222466 |
| wikiData | Q27105903 |