methyl 5-(4-acetyloxy-2,5,5,8a-tetramethyl-3-oxo-4a,6,7,8-tetrahydro-4H-naphthalen-1-yl)-3-methylpentanoate
Internal ID | 02edef47-b852-4583-ac4f-269055f96f1e |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | methyl 5-(4-acetyloxy-2,5,5,8a-tetramethyl-3-oxo-4a,6,7,8-tetrahydro-4H-naphthalen-1-yl)-3-methylpentanoate |
SMILES (Canonical) | CC1=C(C2(CCCC(C2C(C1=O)OC(=O)C)(C)C)C)CCC(C)CC(=O)OC |
SMILES (Isomeric) | CC1=C(C2(CCCC(C2C(C1=O)OC(=O)C)(C)C)C)CCC(C)CC(=O)OC |
InChI | InChI=1S/C23H36O5/c1-14(13-18(25)27-7)9-10-17-15(2)19(26)20(28-16(3)24)21-22(4,5)11-8-12-23(17,21)6/h14,20-21H,8-13H2,1-7H3 |
InChI Key | SOEWGIQQJIQOBD-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H36O5 |
Molecular Weight | 392.50 g/mol |
Exact Mass | 392.25627424 g/mol |
Topological Polar Surface Area (TPSA) | 69.70 Ų |
XlogP | 5.10 |
There are no found synonyms. |
![2D Structure of methyl 5-(4-acetyloxy-2,5,5,8a-tetramethyl-3-oxo-4a,6,7,8-tetrahydro-4H-naphthalen-1-yl)-3-methylpentanoate 2D Structure of methyl 5-(4-acetyloxy-2,5,5,8a-tetramethyl-3-oxo-4a,6,7,8-tetrahydro-4H-naphthalen-1-yl)-3-methylpentanoate](https://plantaedb.com/storage/docs/compounds/2023/11/6689ed20-85a4-11ee-b8a9-4927eab5991c.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.24% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.17% | 94.45% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 96.39% | 83.82% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.27% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.54% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 94.60% | 98.95% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 90.52% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.03% | 85.14% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.42% | 91.19% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.27% | 94.33% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 85.14% | 82.69% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 84.08% | 95.71% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.93% | 100.00% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 81.74% | 96.47% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.30% | 100.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.24% | 93.56% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.16% | 95.56% |
CHEMBL5028 | O14672 | ADAM10 | 80.26% | 97.50% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.16% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cistus ladanifer |
PubChem | 162922616 |
LOTUS | LTS0261499 |
wikiData | Q105256904 |