2-[4-Hydroxy-2-(hydroxymethyl)-6-(8-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl)oxy-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | 9413df26-fa5a-4f4c-86b7-740549e68156 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | 2-[4-hydroxy-2-(hydroxymethyl)-6-(8-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl)oxy-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1CCC2(C(C3(C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)C)O)O)O)O)OC9C(C(C(C(O9)C)O)O)O)C)C)O)C)OC1 |
SMILES (Isomeric) | CC1CCC2(C(C3(C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)C)O)O)O)O)OC9C(C(C(C(O9)C)O)O)O)C)C)O)C)OC1 |
InChI | InChI=1S/C45H74O17/c1-19-9-14-44(55-18-19)22(4)45(54)29(62-44)16-27-25-8-7-23-15-24(10-12-42(23,5)26(25)11-13-43(27,45)6)58-41-38(61-40-35(52)33(50)31(48)21(3)57-40)36(53)37(28(17-46)59-41)60-39-34(51)32(49)30(47)20(2)56-39/h19-41,46-54H,7-18H2,1-6H3 |
InChI Key | XJMYGGMHINYFDO-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C45H74O17 |
Molecular Weight | 887.10 g/mol |
Exact Mass | 886.49260089 g/mol |
Topological Polar Surface Area (TPSA) | 256.00 Ų |
XlogP | 0.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.41% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.01% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.46% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.87% | 97.25% |
CHEMBL233 | P35372 | Mu opioid receptor | 94.10% | 97.93% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 93.88% | 97.31% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 93.18% | 95.93% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 92.52% | 96.61% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.51% | 100.00% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 90.83% | 97.53% |
CHEMBL325 | Q13547 | Histone deacetylase 1 | 90.18% | 95.92% |
CHEMBL237 | P41145 | Kappa opioid receptor | 90.13% | 98.10% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 89.76% | 89.05% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 88.68% | 97.50% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 88.55% | 91.71% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 88.48% | 91.49% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 88.46% | 95.50% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 87.98% | 95.00% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 87.61% | 96.21% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 87.45% | 95.58% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 87.30% | 92.98% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.97% | 95.89% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 86.86% | 97.86% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.16% | 92.50% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.94% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.80% | 89.00% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 83.75% | 95.36% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.99% | 95.89% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 81.96% | 92.86% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.72% | 92.94% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.58% | 86.92% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.95% | 92.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.78% | 86.33% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.68% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Asparagus officinalis |
PubChem | 163044385 |
LOTUS | LTS0207694 |
wikiData | Q105329055 |