(2R,3S,4S,5R,6R)-2-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-6-[(1S)-4-[(3R)-3-hydroxybutyl]-3,5,5-trimethylcyclohex-3-en-1-yl]oxyoxane-3,4,5-triol
Internal ID | 2a172834-451d-4e26-b8ba-94205a0b5032 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
IUPAC Name | (2R,3S,4S,5R,6R)-2-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-6-[(1S)-4-[(3R)-3-hydroxybutyl]-3,5,5-trimethylcyclohex-3-en-1-yl]oxyoxane-3,4,5-triol |
SMILES (Canonical) | CC1=C(C(CC(C1)OC2C(C(C(C(O2)COC3C(C(CO3)(CO)O)O)O)O)O)(C)C)CCC(C)O |
SMILES (Isomeric) | CC1=C(C(C[C@H](C1)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO[C@H]3[C@@H]([C@](CO3)(CO)O)O)O)O)O)(C)C)CC[C@@H](C)O |
InChI | InChI=1S/C24H42O11/c1-12-7-14(8-23(3,4)15(12)6-5-13(2)26)34-21-19(29)18(28)17(27)16(35-21)9-32-22-20(30)24(31,10-25)11-33-22/h13-14,16-22,25-31H,5-11H2,1-4H3/t13-,14+,16-,17-,18+,19-,20+,21-,22-,24-/m1/s1 |
InChI Key | KMKOQWRLJQCOTQ-MGHXVNAPSA-N |
Popularity | 0 references in papers |
Molecular Formula | C24H42O11 |
Molecular Weight | 506.60 g/mol |
Exact Mass | 506.27271215 g/mol |
Topological Polar Surface Area (TPSA) | 179.00 Ų |
XlogP | -1.50 |
There are no found synonyms. |
![2D Structure of (2R,3S,4S,5R,6R)-2-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-6-[(1S)-4-[(3R)-3-hydroxybutyl]-3,5,5-trimethylcyclohex-3-en-1-yl]oxyoxane-3,4,5-triol 2D Structure of (2R,3S,4S,5R,6R)-2-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-6-[(1S)-4-[(3R)-3-hydroxybutyl]-3,5,5-trimethylcyclohex-3-en-1-yl]oxyoxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/63440110-858c-11ee-9e46-6916206fad88.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.51% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 96.98% | 95.93% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.59% | 96.09% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 92.73% | 92.98% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.31% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.41% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 91.11% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.25% | 97.25% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.09% | 96.47% |
CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 88.21% | 97.47% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 87.99% | 98.75% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 87.31% | 96.61% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 87.10% | 86.92% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.60% | 95.89% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.00% | 96.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.68% | 95.56% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 84.90% | 97.21% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 84.64% | 92.86% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.60% | 94.73% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.91% | 96.90% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.90% | 89.00% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 82.44% | 89.05% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 81.93% | 97.36% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 81.40% | 93.18% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.35% | 95.89% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.65% | 92.94% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.41% | 100.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.02% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Myrsine seguinii |
PubChem | 162951996 |
LOTUS | LTS0124669 |
wikiData | Q105143006 |