(2R,7aR)-4,4,7a-trimethyl-2-[(2E,4E,6E,8E,10E,12E,14E,16E)-6,11,15-trimethyl-17-(2,6,6-trimethylcyclohexen-1-yl)heptadeca-2,4,6,8,10,12,14,16-octaen-2-yl]-2,5,6,7-tetrahydro-1-benzofuran
Internal ID | 24725ccd-939a-410e-b002-63aa1ec4f520 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Tetraterpenoids > Carotenoids > Xanthophylls |
IUPAC Name | (2R,7aR)-4,4,7a-trimethyl-2-[(2E,4E,6E,8E,10E,12E,14E,16E)-6,11,15-trimethyl-17-(2,6,6-trimethylcyclohexen-1-yl)heptadeca-2,4,6,8,10,12,14,16-octaen-2-yl]-2,5,6,7-tetrahydro-1-benzofuran |
SMILES (Canonical) | CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C2C=C3C(CCCC3(O2)C)(C)C)C)C |
SMILES (Isomeric) | CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(\C)/C=C/C=C(\C)/[C@H]2C=C3[C@](O2)(CCCC3(C)C)C)/C)/C |
InChI | InChI=1S/C40H56O/c1-30(19-13-20-32(3)24-25-35-33(4)23-15-26-38(35,6)7)17-11-12-18-31(2)21-14-22-34(5)36-29-37-39(8,9)27-16-28-40(37,10)41-36/h11-14,17-22,24-25,29,36H,15-16,23,26-28H2,1-10H3/b12-11+,19-13+,21-14+,25-24+,30-17+,31-18+,32-20+,34-22+/t36-,40-/m1/s1 |
InChI Key | GFPJSSAOISEBQL-OQXGEZFBSA-N |
Popularity | 0 references in papers |
Molecular Formula | C40H56O |
Molecular Weight | 552.90 g/mol |
Exact Mass | 552.433116406 g/mol |
Topological Polar Surface Area (TPSA) | 9.20 Ų |
XlogP | 12.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.14% | 91.11% |
CHEMBL2061 | P19793 | Retinoid X receptor alpha | 94.61% | 91.67% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 92.29% | 89.63% |
CHEMBL1870 | P28702 | Retinoid X receptor beta | 91.66% | 95.00% |
CHEMBL2004 | P48443 | Retinoid X receptor gamma | 91.62% | 100.00% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.74% | 93.99% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 89.41% | 83.82% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.26% | 95.56% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.23% | 95.50% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.97% | 94.73% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.46% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.83% | 96.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.91% | 100.00% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 85.51% | 91.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.35% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.27% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.19% | 95.89% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.78% | 94.75% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.92% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Calendula officinalis |
Ipomoea batatas |
PubChem | 163004300 |
LOTUS | LTS0080353 |
wikiData | Q105007684 |