[6-(Furan-3-yl)-16-(2-methoxy-2-oxoethyl)-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-11-en-14-yl] 2-methylbut-2-enoate
Internal ID | e8ad4ebe-821a-4440-8a7b-ccf82e01f72d |
Taxonomy | Organoheterocyclic compounds > Naphthopyrans |
IUPAC Name | [6-(furan-3-yl)-16-(2-methoxy-2-oxoethyl)-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-11-en-14-yl] 2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC1C2C=C3C(CCC4(C3CC(=O)OC4C5=COC=C5)C)C(C2=O)(C(C1(C)C)CC(=O)OC)C |
SMILES (Isomeric) | CC=C(C)C(=O)OC1C2C=C3C(CCC4(C3CC(=O)OC4C5=COC=C5)C)C(C2=O)(C(C1(C)C)CC(=O)OC)C |
InChI | InChI=1S/C32H40O8/c1-8-17(2)29(36)40-28-20-13-19-21(32(6,26(20)35)23(30(28,3)4)15-24(33)37-7)9-11-31(5)22(19)14-25(34)39-27(31)18-10-12-38-16-18/h8,10,12-13,16,20-23,27-28H,9,11,14-15H2,1-7H3 |
InChI Key | ZUPIHFVWSWCKSD-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C32H40O8 |
Molecular Weight | 552.70 g/mol |
Exact Mass | 552.27231823 g/mol |
Topological Polar Surface Area (TPSA) | 109.00 Ų |
XlogP | 4.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.21% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.47% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.13% | 96.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.75% | 90.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.17% | 86.33% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 88.46% | 93.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.44% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.84% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.39% | 95.89% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.11% | 94.33% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.24% | 92.62% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.67% | 100.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.11% | 100.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.81% | 99.23% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.50% | 95.56% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 82.31% | 97.79% |
CHEMBL2581 | P07339 | Cathepsin D | 82.28% | 98.95% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 81.22% | 91.24% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 81.19% | 92.88% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.97% | 82.69% |
CHEMBL5028 | O14672 | ADAM10 | 80.69% | 97.50% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.35% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cedrela odorata |
Cipadessa baccifera |
Swietenia macrophylla |
Xylocarpus granatum |
PubChem | 162888474 |
LOTUS | LTS0223508 |
wikiData | Q104202802 |