6-((Z)-pentadec-10-en-1-yl)salicylic acid
| Internal ID | 6c652e39-e344-4049-b2ce-dd748b758455 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Salicylic acid and derivatives > Salicylic acids |
| IUPAC Name | 2-hydroxy-6-[(Z)-pentadec-10-enyl]benzoic acid |
| SMILES (Canonical) | CCCCC=CCCCCCCCCCC1=C(C(=CC=C1)O)C(=O)O |
| SMILES (Isomeric) | CCCC/C=C\CCCCCCCCCC1=C(C(=CC=C1)O)C(=O)O |
| InChI | InChI=1S/C22H34O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19-17-15-18-20(23)21(19)22(24)25/h5-6,15,17-18,23H,2-4,7-14,16H2,1H3,(H,24,25)/b6-5- |
| InChI Key | UEOBFNCQTNUCCY-WAYWQWQTSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.25079494 g/mol |
| Topological Polar Surface Area (TPSA) | 57.50 Ų |
| XlogP | 8.50 |
| 6-((Z)-pentadec-10-en-1-yl)salicylic acid |
| 2-hydroxy-6-[(Z)-pentadec-10-enyl]benzoic acid |
| (Z)-2-hydroxy-6-(pentadec-10-en-1-yl)benzoic acid |
| Anacardic acid 10''Z-monoene |
| CHEBI:186923 |
| BDBM50292424 |
| LMPK15040008 |
| 2-hydroxy-6-(10z)-10-pentadecen-1-yl-benzoic acid |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.08% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.75% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.73% | 99.17% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 92.99% | 92.08% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.21% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 91.91% | 94.73% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.93% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.63% | 86.33% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.04% | 93.56% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 87.53% | 89.63% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 86.14% | 97.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.30% | 96.95% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 83.41% | 93.31% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.78% | 96.00% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 82.52% | 96.25% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.88% | 93.99% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Knema laurina |
| PubChem | 13873062 |
| LOTUS | LTS0073436 |
| wikiData | Q76423414 |