6-Oxocampestanol
Internal ID | 9eb2a9c4-5e45-4bc0-a6c2-16dfd7b69ed6 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Ergostane steroids > Ergosterols and derivatives |
IUPAC Name | (3S,5S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5,6-dimethylheptan-2-yl]-3-hydroxy-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one |
SMILES (Canonical) | CC(C)C(C)CCC(C)C1CCC2C1(CCC3C2CC(=O)C4C3(CCC(C4)O)C)C |
SMILES (Isomeric) | C[C@H](CC[C@@H](C)C(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC(=O)[C@@H]4[C@@]3(CC[C@@H](C4)O)C)C |
InChI | InChI=1S/C28H48O2/c1-17(2)18(3)7-8-19(4)22-9-10-23-21-16-26(30)25-15-20(29)11-13-28(25,6)24(21)12-14-27(22,23)5/h17-25,29H,7-16H2,1-6H3/t18-,19-,20+,21+,22-,23+,24+,25-,27-,28-/m1/s1 |
InChI Key | NBJZGNFIZZWBOJ-JSHJXQBASA-N |
Popularity | 35 references in papers |
Molecular Formula | C28H48O2 |
Molecular Weight | 416.70 g/mol |
Exact Mass | 416.365430770 g/mol |
Topological Polar Surface Area (TPSA) | 37.30 Ų |
XlogP | 8.00 |
6-oxo-campestan-3beta-ol |
168113-32-4 |
(3S,5S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5,6-dimethylheptan-2-yl]-3-hydroxy-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one |
oxocampestanol |
SCHEMBL1517834 |
CHEBI:20747 |
6-oxo-5alpha-campestan-3beta-ol |
LMST01030133 |
(24R)-3beta-hydroxy-5alpha-ergostan-6-one |
Q27109350 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.42% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.51% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.24% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 93.39% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.38% | 91.11% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.30% | 100.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.79% | 90.71% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.20% | 95.89% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 87.80% | 95.93% |
CHEMBL3837 | P07711 | Cathepsin L | 87.05% | 96.61% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.13% | 90.17% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 85.95% | 93.04% |
CHEMBL237 | P41145 | Kappa opioid receptor | 85.36% | 98.10% |
CHEMBL238 | Q01959 | Dopamine transporter | 84.86% | 95.88% |
CHEMBL299 | P17252 | Protein kinase C alpha | 84.68% | 98.03% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 84.43% | 85.31% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.41% | 95.56% |
CHEMBL1871 | P10275 | Androgen Receptor | 83.79% | 96.43% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 83.30% | 95.58% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.63% | 93.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.58% | 95.89% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.40% | 100.00% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 81.18% | 97.05% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.18% | 93.56% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 80.96% | 92.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Catharanthus roseus |
PubChem | 16061347 |
LOTUS | LTS0083204 |
wikiData | Q27109350 |