6-O-Veratroylcatalpol
Internal ID | b8cdedfc-47af-41b1-a322-67d97c67d782 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [(1S,2S,4S,5S,6R,10S)-2-(hydroxymethyl)-10-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl] 3,4-dimethoxybenzoate |
SMILES (Canonical) | COC1=C(C=C(C=C1)C(=O)OC2C3C=COC(C3C4(C2O4)CO)OC5C(C(C(C(O5)CO)O)O)O)OC |
SMILES (Isomeric) | COC1=C(C=C(C=C1)C(=O)O[C@H]2[C@@H]3C=CO[C@H]([C@@H]3[C@@]4([C@H]2O4)CO)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)OC |
InChI | InChI=1S/C24H30O13/c1-31-12-4-3-10(7-13(12)32-2)21(30)35-19-11-5-6-33-22(15(11)24(9-26)20(19)37-24)36-23-18(29)17(28)16(27)14(8-25)34-23/h3-7,11,14-20,22-23,25-29H,8-9H2,1-2H3/t11-,14-,15-,16-,17+,18-,19+,20+,22+,23+,24-/m1/s1 |
InChI Key | JPLOCWOFCUFHBG-PIAIVMLOSA-N |
Popularity | 6 references in papers |
Molecular Formula | C24H30O13 |
Molecular Weight | 526.50 g/mol |
Exact Mass | 526.16864101 g/mol |
Topological Polar Surface Area (TPSA) | 186.00 Ų |
XlogP | -1.00 |
6-O-Veratroylcatalpol |
[(1S,2S,4S,5S,6R,10S)-2-(Hydroxymethyl)-10-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl] 3,4-dimethoxybenzoate |
6-O-Veratroyl Catalpol |
6-O-Veratryl catalposide |
CHEMBL2059078 |
DTXSID90972449 |
2-(Hexopyranosyloxy)-1a-(hydroxymethyl)-1a,1b,2,5a,6,6a-hexahydrooxireno[4,5]cyclopenta[1,2-c]pyran-6-yl 3,4-dimethoxybenzoate |
beta-D-Glucopyranoside, 6-((3,4-dimethoxybenzoyl)oxy)-1a,1b,2,5a,6,6a-hexahydro-1a-(hydroxymethyl)oxireno(4,5)cyclopenta(1,2-c)pyran-2-yl, (1aS-(1aalpha,1bbeta.,2.beta,5abeta,6beta,6aalpha))- |
![2D Structure of 6-O-Veratroylcatalpol 2D Structure of 6-O-Veratroylcatalpol](https://plantaedb.com/storage/docs/compounds/2023/11/6-o-veratroylcatalpol.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 96.03% | 96.21% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.85% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.77% | 86.33% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.12% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.65% | 94.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 92.21% | 90.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 91.55% | 92.94% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.17% | 99.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.53% | 96.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 87.84% | 96.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.75% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 87.19% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.74% | 89.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.96% | 85.14% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 84.98% | 95.83% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.58% | 95.56% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.88% | 86.92% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.08% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Catalpa bignonioides |
Catalpa ovata |
Penstemon barbatus |
Veronica cymbalaria |
Veronica persica |
PubChem | 185862 |
LOTUS | LTS0104151 |
wikiData | Q82956219 |