6-methyl-1-[[(2S,3S)-3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]methyl]-9H-carbazole-2,7-diol
| Internal ID | a76418e5-b177-4e58-ac3a-f4265df7d468 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | 6-methyl-1-[[(2S,3S)-3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]methyl]-9H-carbazole-2,7-diol |
| SMILES (Canonical) | CC1=CC2=C(C=C1O)NC3=C2C=CC(=C3CC4C(O4)(C)CCC=C(C)C)O |
| SMILES (Isomeric) | CC1=CC2=C(C=C1O)NC3=C2C=CC(=C3C[C@H]4[C@](O4)(C)CCC=C(C)C)O |
| InChI | InChI=1S/C23H27NO3/c1-13(2)6-5-9-23(4)21(27-23)11-17-19(25)8-7-15-16-10-14(3)20(26)12-18(16)24-22(15)17/h6-8,10,12,21,24-26H,5,9,11H2,1-4H3/t21-,23-/m0/s1 |
| InChI Key | UYTBVHGZBBQOOF-GMAHTHKFSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.19909372 g/mol |
| Topological Polar Surface Area (TPSA) | 68.80 Ų |
| XlogP | 5.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.81% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 99.65% | 91.49% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.95% | 94.45% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 96.81% | 94.75% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.33% | 89.00% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 91.12% | 93.40% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 90.93% | 98.59% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.55% | 95.56% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 89.53% | 92.94% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.40% | 98.95% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.83% | 100.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.82% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.38% | 86.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.02% | 97.09% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 86.64% | 91.79% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.05% | 94.73% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.44% | 99.15% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 83.66% | 93.99% |
| CHEMBL279 | P35968 | Vascular endothelial growth factor receptor 2 | 83.37% | 95.52% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 82.61% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.04% | 95.89% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.72% | 91.71% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.59% | 85.14% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 80.05% | 88.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Bergera euchrestifolia |
| PubChem | 163194533 |
| LOTUS | LTS0073423 |
| wikiData | Q105281926 |