6-methoxy-7-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one
Internal ID | e91dede9-889d-4cb5-acf1-24b448eced68 |
Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives > Coumarin glycosides |
IUPAC Name | 6-methoxy-7-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one |
SMILES (Canonical) | COC1=C(C=C2C(=C1)C=CC(=O)O2)OC3C(C(C(C(O3)CO)O)O)O |
SMILES (Isomeric) | COC1=C(C=C2C(=C1)C=CC(=O)O2)O[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O |
InChI | InChI=1S/C16H18O9/c1-22-9-4-7-2-3-12(18)23-8(7)5-10(9)24-16-15(21)14(20)13(19)11(6-17)25-16/h2-5,11,13-17,19-21H,6H2,1H3/t11-,13-,14+,15-,16+/m1/s1 |
InChI Key | SGTCGCCQZOUMJJ-JZYAIQKZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C16H18O9 |
Molecular Weight | 354.31 g/mol |
Exact Mass | 354.09508215 g/mol |
Topological Polar Surface Area (TPSA) | 135.00 Ų |
XlogP | -1.10 |
There are no found synonyms. |
![2D Structure of 6-methoxy-7-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one 2D Structure of 6-methoxy-7-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/6-methoxy-7-2r3r4s5s6r-345-trihydroxy-6-hydroxymethyloxan-2-yloxychromen-2-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL3242 | O43570 | Carbonic anhydrase XII |
780 nM |
Ki |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL220 | P22303 | Acetylcholinesterase | 98.58% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.17% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.88% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 92.87% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.06% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.73% | 99.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.65% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.06% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.71% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.67% | 85.14% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.10% | 94.73% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 82.81% | 94.03% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.62% | 86.92% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.03% | 89.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Astragalus onobrychis |
Murraya paniculata |
PubChem | 163057653 |
LOTUS | LTS0223406 |
wikiData | Q105252594 |