6-Methoxy-2-[2-(3-methoxy-4-hydroxyphenyl)ethyl]chromone
| Internal ID | ac7ce33b-25d6-4c95-9b70-e594b413b7dd |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Chromones |
| IUPAC Name | 2-[2-(4-hydroxy-3-methoxyphenyl)ethyl]-6-methoxychromen-4-one |
| SMILES (Canonical) | COC1=CC2=C(C=C1)OC(=CC2=O)CCC3=CC(=C(C=C3)O)OC |
| SMILES (Isomeric) | COC1=CC2=C(C=C1)OC(=CC2=O)CCC3=CC(=C(C=C3)O)OC |
| InChI | InChI=1S/C19H18O5/c1-22-13-6-8-18-15(10-13)17(21)11-14(24-18)5-3-12-4-7-16(20)19(9-12)23-2/h4,6-11,20H,3,5H2,1-2H3 |
| InChI Key | RKQVUUSDXYBSJQ-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.11542367 g/mol |
| Topological Polar Surface Area (TPSA) | 65.00 Ų |
| XlogP | 3.40 |
| There are no found synonyms. |
![2D Structure of 6-Methoxy-2-[2-(3-methoxy-4-hydroxyphenyl)ethyl]chromone](https://plantaedb.com/storage/docs/compounds/2023/11/6-methoxy-2-2-3-methoxy-4-hydroxyphenylethylchromone.jpg "2D Structure of 6-Methoxy-2-[2-(3-methoxy-4-hydroxyphenyl)ethyl]chromone")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.55% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.09% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.96% | 95.56% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.58% | 99.15% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.82% | 99.17% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 92.79% | 86.92% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.77% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.98% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.86% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 90.52% | 98.75% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 89.48% | 92.62% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.81% | 95.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.76% | 95.89% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.30% | 94.73% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.94% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.43% | 90.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.23% | 89.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.08% | 93.99% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Aquilaria malaccensis |
| PubChem | 10969435 |
| LOTUS | LTS0274820 |
| wikiData | Q105238730 |