6-Hydroxykaempferol 3-rutinoside 6-glucoside
Internal ID | 379453f6-8c64-4fba-87f8-9a490d779574 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(OC4=C(C3=O)C(=C(C(=C4)O)OC5C(C(C(C(O5)CO)O)O)O)O)C6=CC=C(C=C6)O)O)O)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(OC4=C(C3=O)C(=C(C(=C4)O)OC5C(C(C(C(O5)CO)O)O)O)O)C6=CC=C(C=C6)O)O)O)O)O)O)O |
InChI | InChI=1S/C33H40O21/c1-9-17(37)22(42)25(45)31(49-9)48-8-15-19(39)24(44)27(47)33(52-15)54-30-21(41)16-13(50-28(30)10-2-4-11(35)5-3-10)6-12(36)29(20(16)40)53-32-26(46)23(43)18(38)14(7-34)51-32/h2-6,9,14-15,17-19,22-27,31-40,42-47H,7-8H2,1H3 |
InChI Key | NEXCWFVNYYIZCR-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C33H40O21 |
Molecular Weight | 772.70 g/mol |
Exact Mass | 772.20620828 g/mol |
Topological Polar Surface Area (TPSA) | 345.00 Ų |
XlogP | -3.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.58% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.88% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.66% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.77% | 94.00% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 94.71% | 95.64% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.79% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.11% | 94.73% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.35% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.05% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.93% | 99.15% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.31% | 99.17% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 88.13% | 91.49% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 85.93% | 97.36% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 85.53% | 86.92% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.74% | 97.09% |
CHEMBL3194 | P02766 | Transthyretin | 83.19% | 90.71% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 83.16% | 95.78% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.58% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.56% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.17% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Carthamus tinctorius |
PubChem | 74978444 |
LOTUS | LTS0112998 |
wikiData | Q105178249 |