6-Hydroxy-3-[(3-hydroxy-4-methoxyphenyl)methyl]-7-methoxy-2,3-dihydrochromen-4-one
Internal ID | 7f261d34-08f1-4268-89e9-047c45e48e0c |
Taxonomy | Phenylpropanoids and polyketides > Homoisoflavonoids > Homoisoflavans > Homoisoflavanones |
IUPAC Name | 6-hydroxy-3-[(3-hydroxy-4-methoxyphenyl)methyl]-7-methoxy-2,3-dihydrochromen-4-one |
SMILES (Canonical) | COC1=C(C=C(C=C1)CC2COC3=CC(=C(C=C3C2=O)O)OC)O |
SMILES (Isomeric) | COC1=C(C=C(C=C1)CC2COC3=CC(=C(C=C3C2=O)O)OC)O |
InChI | InChI=1S/C18H18O6/c1-22-15-4-3-10(6-13(15)19)5-11-9-24-16-8-17(23-2)14(20)7-12(16)18(11)21/h3-4,6-8,11,19-20H,5,9H2,1-2H3 |
InChI Key | SRELMISQECCDFT-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H18O6 |
Molecular Weight | 330.30 g/mol |
Exact Mass | 330.11033829 g/mol |
Topological Polar Surface Area (TPSA) | 85.20 Ų |
XlogP | 2.60 |
There are no found synonyms. |
![2D Structure of 6-Hydroxy-3-[(3-hydroxy-4-methoxyphenyl)methyl]-7-methoxy-2,3-dihydrochromen-4-one 2D Structure of 6-Hydroxy-3-[(3-hydroxy-4-methoxyphenyl)methyl]-7-methoxy-2,3-dihydrochromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/6-hydroxy-3-3-hydroxy-4-methoxyphenylmethyl-7-methoxy-23-dihydrochromen-4-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.30% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 96.01% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.00% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.09% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.92% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.11% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.22% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.99% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.78% | 94.45% |
CHEMBL2535 | P11166 | Glucose transporter | 86.44% | 98.75% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.29% | 92.62% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 84.59% | 90.20% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.49% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.90% | 89.00% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 81.12% | 95.53% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 80.96% | 96.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.88% | 90.00% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.73% | 96.77% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.02% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Pterocarpus marsupium |
PubChem | 15406749 |
LOTUS | LTS0102307 |
wikiData | Q105259025 |