6-Hydroxy-2,9-dihydropyrido[3,4-b]indol-1-one
| Internal ID | aec2e246-1149-426d-af6c-e53fe4d9bea8 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Pyridoindoles > Beta carbolines |
| IUPAC Name | 6-hydroxy-2,9-dihydropyrido[3,4-b]indol-1-one |
| SMILES (Canonical) | C1=CC2=C(C=C1O)C3=C(N2)C(=O)NC=C3 |
| SMILES (Isomeric) | C1=CC2=C(C=C1O)C3=C(N2)C(=O)NC=C3 |
| InChI | InChI=1S/C11H8N2O2/c14-6-1-2-9-8(5-6)7-3-4-12-11(15)10(7)13-9/h1-5,13-14H,(H,12,15) |
| InChI Key | QWJCGSWHDROYHG-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C11H8N2O2 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.058577502 g/mol |
| Topological Polar Surface Area (TPSA) | 65.10 Ų |
| XlogP | 1.40 |
| There are no found synonyms. |
![2D Structure of 6-Hydroxy-2,9-dihydropyrido[3,4-b]indol-1-one](https://plantaedb.com/storage/docs/compounds/2023/11/6-hydroxy-29-dihydropyrido34-bindol-1-one.jpg "2D Structure of 6-Hydroxy-2,9-dihydropyrido[3,4-b]indol-1-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.23% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.56% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.36% | 95.56% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 91.49% | 95.56% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 90.68% | 83.82% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 90.61% | 91.71% |
| CHEMBL3553 | P29597 | Tyrosine-protein kinase TYK2 | 90.45% | 97.09% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 90.00% | 91.49% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 88.83% | 93.40% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 88.32% | 83.10% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.75% | 98.75% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.64% | 89.00% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 86.62% | 98.59% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.06% | 98.95% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.85% | 94.75% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.90% | 92.94% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 83.43% | 93.24% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.59% | 85.14% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 80.50% | 97.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.47% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Picrasma quassioides |
| PubChem | 46702470 |
| LOTUS | LTS0124259 |
| wikiData | Q105229217 |