6-Ethyl-11-hydroxy-1'-methoxyspiro[10-oxa-5-azatricyclo[5.3.1.04,8]undec-5-ene-2,3'-indole]-2'-one
Internal ID | ddaf5b3f-d42c-4987-a79f-4ab1f70f550c |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives |
IUPAC Name | 6-ethyl-11-hydroxy-1'-methoxyspiro[10-oxa-5-azatricyclo[5.3.1.04,8]undec-5-ene-2,3'-indole]-2'-one |
SMILES (Canonical) | CCC1=NC2CC3(C4C(C1C2CO4)O)C5=CC=CC=C5N(C3=O)OC |
SMILES (Isomeric) | CCC1=NC2CC3(C4C(C1C2CO4)O)C5=CC=CC=C5N(C3=O)OC |
InChI | InChI=1S/C19H22N2O4/c1-3-12-15-10-9-25-17(16(15)22)19(8-13(10)20-12)11-6-4-5-7-14(11)21(24-2)18(19)23/h4-7,10,13,15-17,22H,3,8-9H2,1-2H3 |
InChI Key | FLDAHLDTMBMPJD-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H22N2O4 |
Molecular Weight | 342.40 g/mol |
Exact Mass | 342.15795719 g/mol |
Topological Polar Surface Area (TPSA) | 71.40 Ų |
XlogP | 0.30 |
There are no found synonyms. |
![2D Structure of 6-Ethyl-11-hydroxy-1'-methoxyspiro[10-oxa-5-azatricyclo[5.3.1.04,8]undec-5-ene-2,3'-indole]-2'-one 2D Structure of 6-Ethyl-11-hydroxy-1'-methoxyspiro[10-oxa-5-azatricyclo[5.3.1.04,8]undec-5-ene-2,3'-indole]-2'-one](https://plantaedb.com/storage/docs/compounds/2023/11/6-ethyl-11-hydroxy-1-methoxyspiro10-oxa-5-azatricyclo531048undec-5-ene-23-indole-2-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.57% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 95.08% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.10% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.74% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.77% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.46% | 85.14% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.86% | 99.23% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.84% | 94.45% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.09% | 94.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.64% | 97.09% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 81.62% | 93.65% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gelsemium elegans |
Gelsemium sempervirens |
PubChem | 5318095 |
LOTUS | LTS0240288 |
wikiData | Q104996966 |