6-[(3S,3aR,6S,6aR)-6-hydroxy-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-1,3-benzodioxol-5-ol
| Internal ID | f8f912f0-7ee5-4226-80a4-ffbd46aa1aa7 |
| Taxonomy | Organoheterocyclic compounds > Benzodioxoles |
| IUPAC Name | 6-[(3S,3aR,6S,6aR)-6-hydroxy-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-1,3-benzodioxol-5-ol |
| SMILES (Canonical) | C1C2C(COC2O)C(O1)C3=CC4=C(C=C3O)OCO4 |
| SMILES (Isomeric) | C1[C@H]2[C@H](CO[C@@H]2O)[C@H](O1)C3=CC4=C(C=C3O)OCO4 |
| InChI | InChI=1S/C13H14O6/c14-9-2-11-10(18-5-19-11)1-6(9)12-7-3-17-13(15)8(7)4-16-12/h1-2,7-8,12-15H,3-5H2/t7-,8-,12+,13-/m0/s1 |
| InChI Key | WQXKWXBSRXGYLX-VLIVSTDHSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C13H14O6 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.07903816 g/mol |
| Topological Polar Surface Area (TPSA) | 77.40 Ų |
| XlogP | 0.50 |
| There are no found synonyms. |
![2D Structure of 6-[(3S,3aR,6S,6aR)-6-hydroxy-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-1,3-benzodioxol-5-ol](https://plantaedb.com/storage/docs/compounds/2023/11/6-3s3ar6s6ar-6-hydroxy-133a466a-hexahydrofuro34-cfuran-3-yl-13-benzodioxol-5-ol.jpg "2D Structure of 6-[(3S,3aR,6S,6aR)-6-hydroxy-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-1,3-benzodioxol-5-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.60% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.21% | 98.95% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 88.89% | 96.77% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.80% | 89.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.95% | 92.62% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 87.14% | 93.40% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.18% | 95.56% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 85.12% | 95.93% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.96% | 100.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.83% | 96.09% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 81.29% | 93.24% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 80.94% | 80.96% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.42% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Sesamum indicum |
| PubChem | 101417416 |
| LOTUS | LTS0150831 |
| wikiData | Q105311047 |