6-(3,4-Dimethoxyphenyl)benzo[f][2,7]naphthyridin-4-one
| Internal ID | dcf139f0-ec1c-4e68-9c20-8f1d80c3f0be |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Phenylquinolines |
| IUPAC Name | 6-(3,4-dimethoxyphenyl)benzo[f][2,7]naphthyridin-4-one |
| SMILES (Canonical) | COC1=C(C=C(C=C1)N2C=C3C(=CC=NC3=O)C4=CC=CC=C42)OC |
| SMILES (Isomeric) | COC1=C(C=C(C=C1)N2C=C3C(=CC=NC3=O)C4=CC=CC=C42)OC |
| InChI | InChI=1S/C20H16N2O3/c1-24-18-8-7-13(11-19(18)25-2)22-12-16-14(9-10-21-20(16)23)15-5-3-4-6-17(15)22/h3-12H,1-2H3 |
| InChI Key | OWAVOYPOZCUWDT-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H16N2O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.11609238 g/mol |
| Topological Polar Surface Area (TPSA) | 51.10 Ų |
| XlogP | 2.50 |
| There are no found synonyms. |
![2D Structure of 6-(3,4-Dimethoxyphenyl)benzo[f][2,7]naphthyridin-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/6-34-dimethoxyphenylbenzof27naphthyridin-4-one.jpg "2D Structure of 6-(3,4-Dimethoxyphenyl)benzo[f][2,7]naphthyridin-4-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.30% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.88% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.27% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.85% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.34% | 98.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.57% | 94.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.49% | 98.75% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 92.22% | 91.49% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 92.15% | 96.47% |
| CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 91.30% | 90.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.09% | 89.00% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 88.06% | 89.62% |
| CHEMBL2094121 | P14867 | GABA-A receptor; alpha-1/beta-3/gamma-2 | 87.61% | 95.50% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 87.54% | 96.67% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.34% | 93.99% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 86.45% | 97.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.46% | 96.00% |
| CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 84.82% | 100.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.21% | 94.75% |
| CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 83.89% | 92.38% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.14% | 99.23% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 82.82% | 93.65% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 82.75% | 96.00% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.55% | 100.00% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 82.02% | 92.67% |
| CHEMBL5903 | Q04771 | Activin receptor type-1 | 81.27% | 89.93% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.69% | 95.83% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Festuca arundinacea |
| Festuca pratensis |
| PubChem | 420115 |
| LOTUS | LTS0124418 |
| wikiData | Q104387204 |