[6-[2-(1,4-Dihydroxycyclohexyl)ethoxy]-3,4,5-trihydroxyoxan-2-yl]methyl 2-(4-hydroxyphenyl)acetate
| Internal ID | ba5b0d72-2c4a-47fe-84cf-932e30f8ab01 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > O-glycosyl compounds |
| IUPAC Name | [6-[2-(1,4-dihydroxycyclohexyl)ethoxy]-3,4,5-trihydroxyoxan-2-yl]methyl 2-(4-hydroxyphenyl)acetate |
| SMILES (Canonical) | C1CC(CCC1O)(CCOC2C(C(C(C(O2)COC(=O)CC3=CC=C(C=C3)O)O)O)O)O |
| SMILES (Isomeric) | C1CC(CCC1O)(CCOC2C(C(C(C(O2)COC(=O)CC3=CC=C(C=C3)O)O)O)O)O |
| InChI | InChI=1S/C22H32O10/c23-14-3-1-13(2-4-14)11-17(25)31-12-16-18(26)19(27)20(28)21(32-16)30-10-9-22(29)7-5-15(24)6-8-22/h1-4,15-16,18-21,23-24,26-29H,5-12H2 |
| InChI Key | CIJZZWKWDSLZRK-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H32O10 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.19954721 g/mol |
| Topological Polar Surface Area (TPSA) | 166.00 Ų |
| XlogP | -0.60 |
| There are no found synonyms. |
![2D Structure of [6-[2-(1,4-Dihydroxycyclohexyl)ethoxy]-3,4,5-trihydroxyoxan-2-yl]methyl 2-(4-hydroxyphenyl)acetate](https://plantaedb.com/storage/docs/compounds/2023/11/6-2-14-dihydroxycyclohexylethoxy-345-trihydroxyoxan-2-ylmethyl-2-4-hydroxyphenylacetate.jpg "2D Structure of [6-[2-(1,4-Dihydroxycyclohexyl)ethoxy]-3,4,5-trihydroxyoxan-2-yl]methyl 2-(4-hydroxyphenyl)acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.99% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.04% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.80% | 97.09% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 92.26% | 94.62% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.15% | 95.89% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.86% | 94.45% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 90.22% | 89.67% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.31% | 98.95% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.22% | 95.89% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.87% | 99.17% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 84.78% | 85.31% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 83.93% | 94.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.18% | 89.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.04% | 97.25% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.18% | 94.00% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.73% | 85.00% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 80.62% | 94.23% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.45% | 90.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Forsythia suspensa |
| PubChem | 14311127 |
| LOTUS | LTS0243441 |
| wikiData | Q104959895 |