(5S)-1,7-bis(4-hydroxyphenyl)-5-[(2S,3R,4R,5S)-3,4,5-trihydroxyoxan-2-yl]oxyheptan-3-one
| Internal ID | 3440f970-f8b8-498a-aee2-4dc76f66a4f4 |
| Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Linear diarylheptanoids > Curcuminoids |
| IUPAC Name | (5S)-1,7-bis(4-hydroxyphenyl)-5-[(2S,3R,4R,5S)-3,4,5-trihydroxyoxan-2-yl]oxyheptan-3-one |
| SMILES (Canonical) | C1C(C(C(C(O1)OC(CCC2=CC=C(C=C2)O)CC(=O)CCC3=CC=C(C=C3)O)O)O)O |
| SMILES (Isomeric) | C1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H](CCC2=CC=C(C=C2)O)CC(=O)CCC3=CC=C(C=C3)O)O)O)O |
| InChI | InChI=1S/C24H30O8/c25-17-7-1-15(2-8-17)5-11-19(27)13-20(12-6-16-3-9-18(26)10-4-16)32-24-23(30)22(29)21(28)14-31-24/h1-4,7-10,20-26,28-30H,5-6,11-14H2/t20-,21-,22+,23+,24-/m0/s1 |
| InChI Key | GTGWRSYHHGXYAS-FCUGFLGKSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C24H30O8 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.19406791 g/mol |
| Topological Polar Surface Area (TPSA) | 137.00 Ų |
| XlogP | 1.20 |
| There are no found synonyms. |
![2D Structure of (5S)-1,7-bis(4-hydroxyphenyl)-5-[(2S,3R,4R,5S)-3,4,5-trihydroxyoxan-2-yl]oxyheptan-3-one](https://plantaedb.com/storage/docs/compounds/2023/11/5s-17-bis4-hydroxyphenyl-5-2s3r4r5s-345-trihydroxyoxan-2-yloxyheptan-3-one.jpg "2D Structure of (5S)-1,7-bis(4-hydroxyphenyl)-5-[(2S,3R,4R,5S)-3,4,5-trihydroxyoxan-2-yl]oxyheptan-3-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.40% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.78% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.37% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.57% | 99.17% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 92.38% | 94.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.84% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.89% | 97.09% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.30% | 90.71% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.45% | 95.89% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.11% | 98.75% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 84.22% | 95.17% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 83.20% | 100.00% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 82.02% | 85.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.88% | 97.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Alnus japonica |
| PubChem | 154497237 |
| LOTUS | LTS0204149 |
| wikiData | Q105018669 |