(5R)-5-tetradec-5-enyloxolan-2-one
Internal ID | 8d0cbfb1-fc33-4e58-aa22-cd8444a82ced |
Taxonomy | Organoheterocyclic compounds > Lactones > Gamma butyrolactones |
IUPAC Name | (5R)-5-tetradec-5-enyloxolan-2-one |
SMILES (Canonical) | CCCCCCCCC=CCCCCC1CCC(=O)O1 |
SMILES (Isomeric) | CCCCCCCCC=CCCCC[C@@H]1CCC(=O)O1 |
InChI | InChI=1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17-15-16-18(19)20-17/h9-10,17H,2-8,11-16H2,1H3/t17-/m1/s1 |
InChI Key | MFJQEKNPFKHQHP-QGZVFWFLSA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H32O2 |
Molecular Weight | 280.40 g/mol |
Exact Mass | 280.240230259 g/mol |
Topological Polar Surface Area (TPSA) | 26.30 Ų |
XlogP | 6.10 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 94.64% | 98.95% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 93.76% | 89.63% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.54% | 99.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.23% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.65% | 95.56% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 86.62% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.96% | 97.09% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.37% | 92.50% |
CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 82.84% | 90.24% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 82.71% | 91.81% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 82.13% | 92.08% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 81.96% | 97.79% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 81.89% | 90.08% |
CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 80.08% | 94.66% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Crossosoma bigelovii |
PubChem | 162974355 |
LOTUS | LTS0076948 |
wikiData | Q105162774 |