(5R)-3-methyl-10-[(4E)-4-(4-methyl-5-oxofuran-2-ylidene)butyl]-1-oxa-10-azaspiro[4.5]dec-3-en-2-one
| Internal ID | 530aa457-170e-4470-8a33-cae28d7daf51 |
| Taxonomy | Organoheterocyclic compounds > Azaspirodecane derivatives |
| IUPAC Name | (5R)-3-methyl-10-[(4E)-4-(4-methyl-5-oxofuran-2-ylidene)butyl]-1-oxa-10-azaspiro[4.5]dec-3-en-2-one |
| SMILES (Canonical) | CC1=CC(=CCCCN2CCCCC23C=C(C(=O)O3)C)OC1=O |
| SMILES (Isomeric) | CC1=C/C(=C\CCCN2CCCC[C@@]23C=C(C(=O)O3)C)/OC1=O |
| InChI | InChI=1S/C18H23NO4/c1-13-11-15(22-16(13)20)7-3-5-9-19-10-6-4-8-18(19)12-14(2)17(21)23-18/h7,11-12H,3-6,8-10H2,1-2H3/b15-7+/t18-/m1/s1 |
| InChI Key | IMWDTVAWMRQOGN-YLRAASNFSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.16270821 g/mol |
| Topological Polar Surface Area (TPSA) | 55.80 Ų |
| XlogP | 2.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.42% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.78% | 95.56% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 95.48% | 93.99% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.22% | 90.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.48% | 86.33% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.71% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.54% | 96.09% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.86% | 94.75% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 84.07% | 96.25% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 83.18% | 95.92% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 82.19% | 89.63% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.26% | 95.89% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 81.22% | 94.66% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.78% | 91.11% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 80.13% | 93.40% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Pandanus amaryllifolius |
| PubChem | 162846668 |
| LOTUS | LTS0077935 |
| wikiData | Q105115973 |