[8-acetyloxy-8a-(acetyloxymethyl)-5-(5-ethoxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-2-yl)-3-hydroxy-5,6-dimethylspiro[3,4,4a,6,7,8-hexahydro-2H-naphthalene-1,2'-oxirane]-2-yl] 2-methylpropanoate
| Internal ID | 22a0a351-953e-4f6a-9dac-1e751c005435 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Tricarboxylic acids and derivatives |
| IUPAC Name | [8-acetyloxy-8a-(acetyloxymethyl)-5-(5-ethoxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-2-yl)-3-hydroxy-5,6-dimethylspiro[3,4,4a,6,7,8-hexahydro-2H-naphthalene-1,2'-oxirane]-2-yl] 2-methylpropanoate |
| SMILES (Canonical) | CCOC1CC2CC(OC2O1)C3(C(CC(C4(C3CC(C(C45CO5)OC(=O)C(C)C)O)COC(=O)C)OC(=O)C)C)C |
| SMILES (Isomeric) | CCOC1CC2CC(OC2O1)C3(C(CC(C4(C3CC(C(C45CO5)OC(=O)C(C)C)O)COC(=O)C)OC(=O)C)C)C |
| InChI | InChI=1S/C30H46O11/c1-8-35-24-11-19-10-22(39-27(19)40-24)28(7)16(4)9-23(38-18(6)32)29(13-36-17(5)31)21(28)12-20(33)25(30(29)14-37-30)41-26(34)15(2)3/h15-16,19-25,27,33H,8-14H2,1-7H3 |
| InChI Key | NEMGZSJMBWCSHO-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C30H46O11 |
| Molecular Weight | 582.70 g/mol |
| Exact Mass | 582.30401228 g/mol |
| Topological Polar Surface Area (TPSA) | 139.00 Ų |
| XlogP | 2.90 |
| Atomic LogP (AlogP) | 2.75 |
| H-Bond Acceptor | 11 |
| H-Bond Donor | 1 |
| Rotatable Bonds | 8 |
| There are no found synonyms. |
![2D Structure of [8-acetyloxy-8a-(acetyloxymethyl)-5-(5-ethoxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-2-yl)-3-hydroxy-5,6-dimethylspiro[3,4,4a,6,7,8-hexahydro-2H-naphthalene-1,2'-oxirane]-2-yl] 2-methylpropanoate](https://plantaedb.com/storage/docs/compounds/2023/11/5f675390-856b-11ee-b5ce-19c50217832b.jpg "2D Structure of [8-acetyloxy-8a-(acetyloxymethyl)-5-(5-ethoxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-2-yl)-3-hydroxy-5,6-dimethylspiro[3,4,4a,6,7,8-hexahydro-2H-naphthalene-1,2'-oxirane]-2-yl] 2-methylpropanoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9765 | 97.65% |
| Caco-2 | - | 0.7652 | 76.52% |
| Blood Brain Barrier | + | 0.7000 | 70.00% |
| Human oral bioavailability | - | 0.6143 | 61.43% |
| Subcellular localzation | Mitochondria | 0.7266 | 72.66% |
| OATP2B1 inhibitior | - | 0.8591 | 85.91% |
| OATP1B1 inhibitior | + | 0.8544 | 85.44% |
| OATP1B3 inhibitior | + | 0.8691 | 86.91% |
| MATE1 inhibitior | - | 0.9400 | 94.00% |
| OCT2 inhibitior | - | 0.8000 | 80.00% |
| BSEP inhibitior | + | 0.8051 | 80.51% |
| P-glycoprotein inhibitior | + | 0.6963 | 69.63% |
| P-glycoprotein substrate | + | 0.6345 | 63.45% |
| CYP3A4 substrate | + | 0.6946 | 69.46% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8622 | 86.22% |
| CYP3A4 inhibition | + | 0.5509 | 55.09% |
| CYP2C9 inhibition | - | 0.6828 | 68.28% |
| CYP2C19 inhibition | - | 0.7230 | 72.30% |
| CYP2D6 inhibition | - | 0.9459 | 94.59% |
| CYP1A2 inhibition | - | 0.9220 | 92.20% |
| CYP2C8 inhibition | + | 0.5398 | 53.98% |
| CYP inhibitory promiscuity | - | 0.8658 | 86.58% |
| UGT catelyzed | + | 0.8000 | 80.00% |
| Carcinogenicity (binary) | - | 0.9300 | 93.00% |
| Carcinogenicity (trinary) | Non-required | 0.5290 | 52.90% |
| Eye corrosion | - | 0.9869 | 98.69% |
| Eye irritation | - | 0.8997 | 89.97% |
| Skin irritation | - | 0.6964 | 69.64% |
| Skin corrosion | - | 0.9390 | 93.90% |
| Ames mutagenesis | - | 0.5437 | 54.37% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.5839 | 58.39% |
| Micronuclear | - | 0.6100 | 61.00% |
| Hepatotoxicity | - | 0.5983 | 59.83% |
| skin sensitisation | - | 0.8542 | 85.42% |
| Respiratory toxicity | - | 0.5889 | 58.89% |
| Reproductive toxicity | + | 0.7556 | 75.56% |
| Mitochondrial toxicity | + | 0.7500 | 75.00% |
| Nephrotoxicity | + | 0.8561 | 85.61% |
| Acute Oral Toxicity (c) | I | 0.5256 | 52.56% |
| Estrogen receptor binding | + | 0.7851 | 78.51% |
| Androgen receptor binding | + | 0.7059 | 70.59% |
| Thyroid receptor binding | - | 0.5612 | 56.12% |
| Glucocorticoid receptor binding | + | 0.6812 | 68.12% |
| Aromatase binding | + | 0.7042 | 70.42% |
| PPAR gamma | + | 0.6748 | 67.48% |
| Honey bee toxicity | - | 0.6908 | 69.08% |
| Biodegradation | - | 0.8750 | 87.50% |
| Crustacea aquatic toxicity | - | 0.6755 | 67.55% |
| Fish aquatic toxicity | + | 0.9858 | 98.58% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.91% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.76% | 97.25% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.02% | 94.45% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.83% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.04% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.77% | 98.95% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 93.07% | 98.75% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 92.39% | 95.71% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 92.30% | 89.05% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 92.15% | 91.19% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.07% | 97.09% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 91.00% | 96.47% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 90.69% | 96.77% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 89.53% | 92.62% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 89.05% | 97.21% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 89.04% | 82.50% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 88.73% | 89.50% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 88.25% | 98.03% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 87.09% | 96.95% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 85.40% | 82.69% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.89% | 91.07% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.32% | 86.33% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.10% | 97.14% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.00% | 94.33% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 83.46% | 89.34% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.58% | 89.00% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 82.57% | 97.79% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 82.50% | 91.24% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.39% | 92.50% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.75% | 95.50% |
| CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 81.02% | 87.16% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 80.23% | 97.28% |
| PubChem | 73744540 |
| LOTUS | LTS0096884 |
| wikiData | Q105178051 |