(4S)-4-hydroxy-3,5,5-trimethyl-4-[(3S)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxybutyl]cyclohex-2-en-1-one
Internal ID | af87e184-42f6-475f-be1e-45d17f35d390 |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acyl glycosides > Fatty acyl glycosides of mono- and disaccharides |
IUPAC Name | (4S)-4-hydroxy-3,5,5-trimethyl-4-[(3S)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxybutyl]cyclohex-2-en-1-one |
SMILES (Canonical) | CC1=CC(=O)CC(C1(CCC(C)OC2C(C(C(C(O2)COC3C(C(C(C(O3)CO)O)O)O)O)O)O)O)(C)C |
SMILES (Isomeric) | CC1=CC(=O)CC([C@]1(CC[C@H](C)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O)O)O)O)(C)C |
InChI | InChI=1S/C25H42O13/c1-11-7-13(27)8-24(3,4)25(11,34)6-5-12(2)36-23-21(33)19(31)17(29)15(38-23)10-35-22-20(32)18(30)16(28)14(9-26)37-22/h7,12,14-23,26,28-34H,5-6,8-10H2,1-4H3/t12-,14+,15+,16+,17+,18-,19-,20+,21+,22+,23+,25+/m0/s1 |
InChI Key | GKUGLPQEXXJXHN-FQBJGKEOSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C25H42O13 |
Molecular Weight | 550.60 g/mol |
Exact Mass | 550.26254139 g/mol |
Topological Polar Surface Area (TPSA) | 216.00 Ų |
XlogP | -2.90 |
There are no found synonyms. |
![2D Structure of (4S)-4-hydroxy-3,5,5-trimethyl-4-[(3S)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxybutyl]cyclohex-2-en-1-one 2D Structure of (4S)-4-hydroxy-3,5,5-trimethyl-4-[(3S)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxybutyl]cyclohex-2-en-1-one](https://plantaedb.com/storage/docs/compounds/2023/11/5f35c230-85d6-11ee-af17-a334aa10275e.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.13% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.93% | 97.25% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 97.63% | 83.57% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.76% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 96.39% | 98.95% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 91.82% | 95.93% |
CHEMBL220 | P22303 | Acetylcholinesterase | 91.07% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.93% | 95.56% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 87.06% | 96.47% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.79% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.64% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.27% | 100.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.19% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.87% | 85.14% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.66% | 94.75% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.66% | 96.00% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 83.45% | 96.61% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.38% | 94.45% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 83.08% | 93.04% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.98% | 99.23% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.53% | 95.89% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.04% | 95.89% |
CHEMBL1871 | P10275 | Androgen Receptor | 81.86% | 96.43% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.63% | 94.73% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.30% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Diplospora dubia |
PubChem | 50993405 |
LOTUS | LTS0093013 |
wikiData | Q105010311 |