2-[4,5-Dihydroxy-2-(1,5',7,9,13-pentamethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl)oxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | 31c1daac-4d82-4466-a35c-45d293f0ba3f |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | 2-[4,5-dihydroxy-2-(1,5',7,9,13-pentamethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl)oxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4(CC=C6C5(CCC(C6)OC7C(C(C(C(O7)COC8C(C(C(C(O8)CO)O)O)O)O)O)OC9C(C(C(C(O9)C)O)O)O)C)C)C)C)OC1 |
SMILES (Isomeric) | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4(CC=C6C5(CCC(C6)OC7C(C(C(C(O7)COC8C(C(C(C(O8)CO)O)O)O)O)O)OC9C(C(C(C(O9)C)O)O)O)C)C)C)C)OC1 |
InChI | InChI=1S/C46H74O17/c1-20-7-14-46(57-18-20)21(2)30-25(63-46)16-29-44(5)11-8-23-15-24(9-12-43(23,4)28(44)10-13-45(29,30)6)59-42-39(62-41-38(55)34(51)31(48)22(3)58-41)36(53)33(50)27(61-42)19-56-40-37(54)35(52)32(49)26(17-47)60-40/h8,20-22,24-42,47-55H,7,9-19H2,1-6H3 |
InChI Key | PBPYCGZPPTVJFY-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C46H74O17 |
Molecular Weight | 899.10 g/mol |
Exact Mass | 898.49260089 g/mol |
Topological Polar Surface Area (TPSA) | 256.00 Ų |
XlogP | 1.20 |
There are no found synonyms. |
![2D Structure of 2-[4,5-Dihydroxy-2-(1,5',7,9,13-pentamethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl)oxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-3-yl]oxy-6-methyloxane-3,4,5-triol 2D Structure of 2-[4,5-Dihydroxy-2-(1,5',7,9,13-pentamethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl)oxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-3-yl]oxy-6-methyloxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/5d042f40-8767-11ee-a041-39898463e298.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.02% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.47% | 96.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 98.41% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.43% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.78% | 97.25% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.44% | 89.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.72% | 100.00% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 89.72% | 95.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.25% | 95.89% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.93% | 92.94% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 86.99% | 96.61% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.55% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 84.86% | 98.95% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.78% | 100.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.34% | 92.50% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.21% | 86.92% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.18% | 94.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.03% | 94.45% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.55% | 93.04% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.47% | 94.73% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 82.44% | 97.53% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.18% | 95.89% |
CHEMBL1977 | P11473 | Vitamin D receptor | 80.59% | 99.43% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.46% | 95.83% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.38% | 97.36% |
CHEMBL237 | P41145 | Kappa opioid receptor | 80.19% | 98.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lilium candidum |
PubChem | 162986515 |
LOTUS | LTS0183397 |
wikiData | Q105205345 |