5alpha-Tomatidan-3-one
| Internal ID | 2de70c27-2908-45f1-953c-264e2e0008f7 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal alkaloids > Spirosolanes and derivatives |
| IUPAC Name | 5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-piperidine]-16-one |
| SMILES (Canonical) | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(=O)C6)C)C)C)NC1 |
| SMILES (Isomeric) | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(=O)C6)C)C)C)NC1 |
| InChI | InChI=1S/C27H43NO2/c1-16-7-12-27(28-15-16)17(2)24-23(30-27)14-22-20-6-5-18-13-19(29)8-10-25(18,3)21(20)9-11-26(22,24)4/h16-18,20-24,28H,5-15H2,1-4H3 |
| InChI Key | VCYNHQOAZQMPOJ-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C27H43NO2 |
| Molecular Weight | 413.60 g/mol |
| Exact Mass | 413.329379614 g/mol |
| Topological Polar Surface Area (TPSA) | 38.30 Ų |
| XlogP | 5.80 |
| 5alpha-Tomatidan-3-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.82% | 97.09% |
| CHEMBL204 | P00734 | Thrombin | 95.30% | 96.01% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.33% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.68% | 91.11% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.42% | 100.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.89% | 97.25% |
| CHEMBL1871 | P10275 | Androgen Receptor | 89.25% | 96.43% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.14% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.30% | 95.56% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 86.97% | 85.11% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 86.79% | 96.38% |
| CHEMBL3045 | P05771 | Protein kinase C beta | 86.29% | 97.63% |
| CHEMBL4523377 | Q86WV6 | Stimulator of interferon genes protein | 85.83% | 95.48% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 84.13% | 97.79% |
| CHEMBL233 | P35372 | Mu opioid receptor | 83.87% | 97.93% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 83.75% | 93.04% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 83.14% | 89.05% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 83.13% | 98.03% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 82.61% | 97.05% |
| CHEMBL228 | P31645 | Serotonin transporter | 82.48% | 95.51% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.17% | 92.94% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.85% | 99.23% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 81.65% | 92.88% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 81.10% | 93.18% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.24% | 90.71% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.12% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Solanum aviculare |
| PubChem | 4529149 |
| LOTUS | LTS0089605 |
| wikiData | Q105284033 |