3-[[(2S,3S,4R,5R,6S)-3-(2-carboxyacetyl)oxy-6-[3-[(2S,3S,4S,5S,6S)-6-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-7-hydroxy-2-(3,4,5-trihydroxyphenyl)chromenylium-5-yl]oxy-4,5-dihydroxyoxan-2-yl]methoxy]-3-oxopropanoic acid
Internal ID | fd8db56a-7ada-49dc-9791-bb64c45ac32c |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Anthocyanidin 3-O-p-coumaroyl glycosides > Anthocyanidin 3-O-6-p-coumaroyl glycosides |
IUPAC Name | 3-[[(2S,3S,4R,5R,6S)-3-(2-carboxyacetyl)oxy-6-[3-[(2S,3S,4S,5S,6S)-6-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-7-hydroxy-2-(3,4,5-trihydroxyphenyl)chromenylium-5-yl]oxy-4,5-dihydroxyoxan-2-yl]methoxy]-3-oxopropanoic acid |
SMILES (Canonical) | C1=CC(=C(C=C1C=CC(=O)OCC2C(C(C(C(O2)OC3=C([O+]=C4C=C(C=C(C4=C3)OC5C(C(C(C(O5)COC(=O)CC(=O)O)OC(=O)CC(=O)O)O)O)O)C6=CC(=C(C(=C6)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=C(C=C1/C=C/C(=O)OC[C@H]2[C@H]([C@@H]([C@@H]([C@@H](O2)OC3=C([O+]=C4C=C(C=C(C4=C3)O[C@H]5[C@@H]([C@H]([C@@H]([C@@H](O5)COC(=O)CC(=O)O)OC(=O)CC(=O)O)O)O)O)C6=CC(=C(C(=C6)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C42H40O26/c43-17-8-23-18(24(9-17)64-42-38(60)36(58)40(68-32(54)12-29(50)51)27(67-42)14-62-31(53)11-28(48)49)10-25(39(63-23)16-6-21(46)33(55)22(47)7-16)65-41-37(59)35(57)34(56)26(66-41)13-61-30(52)4-2-15-1-3-19(44)20(45)5-15/h1-10,26-27,34-38,40-42,56-60H,11-14H2,(H7-,43,44,45,46,47,48,49,50,51,52,55)/p+1/t26-,27-,34+,35-,36+,37-,38+,40+,41+,42+/m0/s1 |
InChI Key | ISORUJJVGRWMCI-PIHLMBMESA-O |
Popularity | 0 references in papers |
Molecular Formula | C42H41O26+ |
Molecular Weight | 961.80 g/mol |
Exact Mass | 961.18860641 g/mol |
Topological Polar Surface Area (TPSA) | 414.00 Ų |
XlogP | 0.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.87% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.70% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.53% | 89.00% |
CHEMBL3194 | P02766 | Transthyretin | 96.09% | 90.71% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 95.70% | 99.15% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 95.54% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.44% | 86.33% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 94.69% | 83.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.65% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.35% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.52% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.99% | 94.73% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 84.66% | 97.36% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 84.29% | 95.83% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.20% | 95.50% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 84.15% | 82.50% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.02% | 94.33% |
CHEMBL2581 | P07339 | Cathepsin D | 82.88% | 98.95% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 82.88% | 89.62% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.06% | 92.50% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 81.88% | 94.00% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 81.68% | 97.31% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.56% | 97.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.32% | 90.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Salvia splendens |
PubChem | 154497407 |
LOTUS | LTS0156485 |
wikiData | Q105119678 |