5,8,9-Trimethoxy-2,10-dimethyl-4,5-dihydropyrano[2,3-b]quinoline
| Internal ID | 2cf207bf-52f4-4f09-9159-2fee9cfb6726 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Quinolones and derivatives > Pyranoquinolines |
| IUPAC Name | 5,8,9-trimethoxy-2,10-dimethyl-4,5-dihydropyrano[2,3-b]quinoline |
| SMILES (Canonical) | CC1=CCC2=C(O1)N(C3=C(C2OC)C=CC(=C3OC)OC)C |
| SMILES (Isomeric) | CC1=CCC2=C(O1)N(C3=C(C2OC)C=CC(=C3OC)OC)C |
| InChI | InChI=1S/C17H21NO4/c1-10-6-7-12-15(20-4)11-8-9-13(19-3)16(21-5)14(11)18(2)17(12)22-10/h6,8-9,15H,7H2,1-5H3 |
| InChI Key | JJFMMXSBTATGFV-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.14705815 g/mol |
| Topological Polar Surface Area (TPSA) | 40.20 Ų |
| XlogP | 2.40 |
| There are no found synonyms. |
![2D Structure of 5,8,9-Trimethoxy-2,10-dimethyl-4,5-dihydropyrano[2,3-b]quinoline](https://plantaedb.com/storage/docs/compounds/2023/11/589-trimethoxy-210-dimethyl-45-dihydropyrano23-bquinoline.jpg "2D Structure of 5,8,9-Trimethoxy-2,10-dimethyl-4,5-dihydropyrano[2,3-b]quinoline")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.50% | 96.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.39% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.03% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.62% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.09% | 95.89% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.33% | 89.62% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.53% | 98.95% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 82.10% | 100.00% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 81.96% | 93.65% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.58% | 100.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.24% | 93.99% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.19% | 93.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.21% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Vepris louisii |
| PubChem | 162993554 |
| LOTUS | LTS0022763 |
| wikiData | Q105129626 |